Difference between revisions of "50S-Ribosomal-subunit-protein-L16-Arg"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite 3-SULFINOALANINE == * common-name: ** 3-sulfinoalanine * smiles: ** c(c([n+])c(=o)[o-])s([o-])=o * inchi-key: ** advptqaunprnpo-reohclbhs...") |
(Created page with "Category:metabolite == Metabolite 50S-Ribosomal-subunit-protein-L16-Arg == * common-name: ** a [50s ribosomal subunit protein l16]-l-arginine81 == Reaction(s) known to con...") |
||
| (2 intermediate revisions by 2 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite 50S-Ribosomal-subunit-protein-L16-Arg == |
* common-name: | * common-name: | ||
| − | ** | + | ** a [50s ribosomal subunit protein l16]-l-arginine81 |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN0-7090]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=a [50s ribosomal subunit protein l16]-l-arginine81}} |
| − | |||
| − | |||
Latest revision as of 11:15, 18 March 2021
Contents
Metabolite 50S-Ribosomal-subunit-protein-L16-Arg
- common-name:
- a [50s ribosomal subunit protein l16]-l-arginine81
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
Property "Common-name" (as page type) with input value "a [50s ribosomal subunit protein l16]-l-arginine81" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.
