Difference between revisions of "56-Dihydrouracil16-in-tRNAs"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-17263 == * common-name: ** (8z,11z,14z,17z)-3-hydroxy-icosa-8,11,14,17-tetraenoyl-coa * smiles: ** ccc=ccc=ccc=ccc=cccccc(o)cc(=o)scc...")
(Created page with "Category:metabolite == Metabolite Charged-PRO-tRNAs == * common-name: ** an l-prolyl-[trnapro] == Reaction(s) known to consume the compound == == Reaction(s) known to prod...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-17263 ==
+
== Metabolite Charged-PRO-tRNAs ==
 
* common-name:
 
* common-name:
** (8z,11z,14z,17z)-3-hydroxy-icosa-8,11,14,17-tetraenoyl-coa
+
** an l-prolyl-[trnapro]
* smiles:
 
** ccc=ccc=ccc=ccc=cccccc(o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 
* inchi-key:
 
** pcgphlmaazkqfq-fpxdaddusa-j
 
* molecular-weight:
 
** 1065.958
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-16021]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-16020]]
+
* [[PROLINE--TRNA-LIGASE-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(8z,11z,14z,17z)-3-hydroxy-icosa-8,11,14,17-tetraenoyl-coa}}
+
{{#set: common-name=an l-prolyl-[trnapro]}}
{{#set: inchi-key=inchikey=pcgphlmaazkqfq-fpxdaddusa-j}}
 
{{#set: molecular-weight=1065.958}}
 

Revision as of 18:53, 14 January 2021

Metabolite Charged-PRO-tRNAs

  • common-name:
    • an l-prolyl-[trnapro]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "an l-prolyl-[trnapro" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.