Difference between revisions of "56-Dihydrouracil17-in-tRNAs"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite N-terminal-specific-UCP-E2-L-cysteine == * common-name: ** an [n-terminal e2 ubiquitin-conjugating enzyme]-l-cysteine == Reaction(s) know...")
(Created page with "Category:metabolite == Metabolite CPD-3569 == * common-name: ** glycyl-l-glutamate * smiles: ** c([n+])c(=o)nc(ccc(=o)[o-])c([o-])=o * inchi-key: ** iefjwdngdzaynz-bypyzuc...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite N-terminal-specific-UCP-E2-L-cysteine ==
+
== Metabolite CPD-3569 ==
 
* common-name:
 
* common-name:
** an [n-terminal e2 ubiquitin-conjugating enzyme]-l-cysteine
+
** glycyl-l-glutamate
 +
* smiles:
 +
** c([n+])c(=o)nc(ccc(=o)[o-])c([o-])=o
 +
* inchi-key:
 +
** iefjwdngdzaynz-bypyzucnsa-m
 +
* molecular-weight:
 +
** 203.174
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-15563]]
+
* [[RXN0-6984]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-15564]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=an [n-terminal e2 ubiquitin-conjugating enzyme]-l-cysteine}}
+
{{#set: common-name=glycyl-l-glutamate}}
 +
{{#set: inchi-key=inchikey=iefjwdngdzaynz-bypyzucnsa-m}}
 +
{{#set: molecular-weight=203.174}}

Revision as of 08:30, 15 March 2021

Metabolite CPD-3569

  • common-name:
    • glycyl-l-glutamate
  • smiles:
    • c([n+])c(=o)nc(ccc(=o)[o-])c([o-])=o
  • inchi-key:
    • iefjwdngdzaynz-bypyzucnsa-m
  • molecular-weight:
    • 203.174

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality