Difference between revisions of "56-Dihydrouracil47-in-tRNAs"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite 5Z13E-15S-1115-DIHYDROXY-9-OXOPROS == * common-name: ** prostaglandin e2 * smiles: ** cccccc(o)c=cc1(c(cc=ccccc(=o)[o-])c(=o)cc(o)1) * in...")
(Created page with "Category:metabolite == Metabolite 56-Dihydrouracil47-in-tRNAs == * common-name: ** a 5,6-dihydrouracil47 in trna == Reaction(s) known to consume the compound == == Reactio...")
 
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite 5Z13E-15S-1115-DIHYDROXY-9-OXOPROS ==
+
== Metabolite 56-Dihydrouracil47-in-tRNAs ==
 
* common-name:
 
* common-name:
** prostaglandin e2
+
** a 5,6-dihydrouracil47 in trna
* smiles:
 
** cccccc(o)c=cc1(c(cc=ccccc(=o)[o-])c(=o)cc(o)1)
 
* inchi-key:
 
** xeybrnlfezdvaw-arsrfyassa-m
 
* molecular-weight:
 
** 351.462
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[1.1.1.141-RXN]]
 
* [[PROSTAGLANDIN-E2-9-REDUCTASE-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[1.1.1.141-RXN]]
+
* [[RXN-12457]]
* [[PROSTAGLANDIN-E-SYNTHASE-RXN]]
 
* [[PROSTAGLANDIN-E2-9-REDUCTASE-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=prostaglandin e2}}
+
{{#set: common-name=a 5,6-dihydrouracil47 in trna}}
{{#set: inchi-key=inchikey=xeybrnlfezdvaw-arsrfyassa-m}}
 
{{#set: molecular-weight=351.462}}
 

Latest revision as of 11:15, 18 March 2021

Metabolite 56-Dihydrouracil47-in-tRNAs

  • common-name:
    • a 5,6-dihydrouracil47 in trna

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality