Difference between revisions of "5734-TETRAHYDROXYFLAVONE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite Cytochrome-c-N-O-methyl-arginines == * common-name: ** [cytochrome c]-nω-methyl-arginine == Reaction(s) known to consume the compou...") |
(Created page with "Category:metabolite == Metabolite CPD-9895 == * common-name: ** 3,4-dihydroxy-5-all-trans-decaprenylbenzoate * smiles: ** cc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-9895 == |
* common-name: | * common-name: | ||
| − | ** [ | + | ** 3,4-dihydroxy-5-all-trans-decaprenylbenzoate |
| + | * smiles: | ||
| + | ** cc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(=c(c(=cc(c([o-])=o)=c1)o)o))c)c)c)c)c)c)c)c)c)c | ||
| + | * inchi-key: | ||
| + | ** hgwugdiatlopbn-bhzqgfrmsa-m | ||
| + | * molecular-weight: | ||
| + | ** 834.296 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[RXN-9282]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=3,4-dihydroxy-5-all-trans-decaprenylbenzoate}} |
| + | {{#set: inchi-key=inchikey=hgwugdiatlopbn-bhzqgfrmsa-m}} | ||
| + | {{#set: molecular-weight=834.296}} | ||
Revision as of 11:16, 15 January 2021
Contents
Metabolite CPD-9895
- common-name:
- 3,4-dihydroxy-5-all-trans-decaprenylbenzoate
- smiles:
- cc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(=c(c(=cc(c([o-])=o)=c1)o)o))c)c)c)c)c)c)c)c)c)c
- inchi-key:
- hgwugdiatlopbn-bhzqgfrmsa-m
- molecular-weight:
- 834.296
