Difference between revisions of "5734-TETRAHYDROXYFLAVONE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite 5-HYDROXY-TRYPTOPHAN == * common-name: ** 5-hydroxy-l-tryptophan * smiles: ** c2(nc1(c=cc(o)=cc=1c=2cc(c(=o)[o-])[n+])) * inchi-key: ** l...")
(Created page with "Category:metabolite == Metabolite 5734-TETRAHYDROXYFLAVONE == * common-name: ** luteolin * smiles: ** c1(=c(c=c(o)c(o)=c1)c2(oc3(c=c([o-])c=c(o)c(c(=o)c=2)=3))) * inchi-ke...")
 
(4 intermediate revisions by 3 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite 5-HYDROXY-TRYPTOPHAN ==
+
== Metabolite 5734-TETRAHYDROXYFLAVONE ==
 
* common-name:
 
* common-name:
** 5-hydroxy-l-tryptophan
+
** luteolin
 
* smiles:
 
* smiles:
** c2(nc1(c=cc(o)=cc=1c=2cc(c(=o)[o-])[n+]))
+
** c1(=c(c=c(o)c(o)=c1)c2(oc3(c=c([o-])c=c(o)c(c(=o)c=2)=3)))
 
* inchi-key:
 
* inchi-key:
** ldcyzajdbxycgn-vifpvbqesa-n
+
** iqpnaansbpbgfq-uhfffaoysa-m
 
* molecular-weight:
 
* molecular-weight:
** 220.227
+
** 285.232
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN3DJ-170]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-7651]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=5-hydroxy-l-tryptophan}}
+
{{#set: common-name=luteolin}}
{{#set: inchi-key=inchikey=ldcyzajdbxycgn-vifpvbqesa-n}}
+
{{#set: inchi-key=inchikey=iqpnaansbpbgfq-uhfffaoysa-m}}
{{#set: molecular-weight=220.227}}
+
{{#set: molecular-weight=285.232}}

Latest revision as of 11:14, 18 March 2021

Metabolite 5734-TETRAHYDROXYFLAVONE

  • common-name:
    • luteolin
  • smiles:
    • c1(=c(c=c(o)c(o)=c1)c2(oc3(c=c([o-])c=c(o)c(c(=o)c=2)=3)))
  • inchi-key:
    • iqpnaansbpbgfq-uhfffaoysa-m
  • molecular-weight:
    • 285.232

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality