Difference between revisions of "5734-TETRAHYDROXYFLAVONE"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ16088 == == Organism(s) associated with this gene == * S.japonica_carotenoid_curated == Reaction(s) associated == * 4.2.2.10-RXN ** Catego...") |
(Created page with "Category:metabolite == Metabolite 5734-TETRAHYDROXYFLAVONE == * common-name: ** luteolin * smiles: ** c1(=c(c=c(o)c(o)=c1)c2(oc3(c=c([o-])c=c(o)c(c(=o)c=2)=3))) * inchi-ke...") |
||
(9 intermediate revisions by 5 users not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite 5734-TETRAHYDROXYFLAVONE == |
− | == | + | * common-name: |
− | + | ** luteolin | |
− | == | + | * smiles: |
− | * | + | ** c1(=c(c=c(o)c(o)=c1)c2(oc3(c=c([o-])c=c(o)c(c(=o)c=2)=3))) |
− | + | * inchi-key: | |
− | ** | + | ** iqpnaansbpbgfq-uhfffaoysa-m |
− | * | + | * molecular-weight: |
− | + | ** 285.232 | |
− | ** | + | == Reaction(s) known to consume the compound == |
− | == | + | == Reaction(s) known to produce the compound == |
− | * [[ | + | * [[RXN-7651]] |
− | + | == Reaction(s) of unknown directionality == | |
− | {{#set: | + | {{#set: common-name=luteolin}} |
− | {{#set: | + | {{#set: inchi-key=inchikey=iqpnaansbpbgfq-uhfffaoysa-m}} |
− | {{#set: | + | {{#set: molecular-weight=285.232}} |
Latest revision as of 11:14, 18 March 2021
Contents
Metabolite 5734-TETRAHYDROXYFLAVONE
- common-name:
- luteolin
- smiles:
- c1(=c(c=c(o)c(o)=c1)c2(oc3(c=c([o-])c=c(o)c(c(=o)c=2)=3)))
- inchi-key:
- iqpnaansbpbgfq-uhfffaoysa-m
- molecular-weight:
- 285.232