Difference between revisions of "5734-TETRAHYDROXYFLAVONE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite Cytochrome-c-N-O-methyl-arginines == * common-name: ** [cytochrome c]-nω-methyl-arginine == Reaction(s) known to consume the compou...")
(Created page with "Category:metabolite == Metabolite 5734-TETRAHYDROXYFLAVONE == * common-name: ** luteolin * smiles: ** c1(=c(c=c(o)c(o)=c1)c2(oc3(c=c([o-])c=c(o)c(c(=o)c=2)=3))) * inchi-ke...")
 
(2 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite Cytochrome-c-N-O-methyl-arginines ==
+
== Metabolite 5734-TETRAHYDROXYFLAVONE ==
 
* common-name:
 
* common-name:
** [cytochrome c]-nω-methyl-arginine
+
** luteolin
 +
* smiles:
 +
** c1(=c(c=c(o)c(o)=c1)c2(oc3(c=c([o-])c=c(o)c(c(=o)c=2)=3)))
 +
* inchi-key:
 +
** iqpnaansbpbgfq-uhfffaoysa-m
 +
* molecular-weight:
 +
** 285.232
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[2.1.1.124-RXN]]
+
* [[RXN-7651]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=[cytochrome c]-nω-methyl-arginine}}
+
{{#set: common-name=luteolin}}
 +
{{#set: inchi-key=inchikey=iqpnaansbpbgfq-uhfffaoysa-m}}
 +
{{#set: molecular-weight=285.232}}

Latest revision as of 11:14, 18 March 2021

Metabolite 5734-TETRAHYDROXYFLAVONE

  • common-name:
    • luteolin
  • smiles:
    • c1(=c(c=c(o)c(o)=c1)c2(oc3(c=c([o-])c=c(o)c(c(=o)c=2)=3)))
  • inchi-key:
    • iqpnaansbpbgfq-uhfffaoysa-m
  • molecular-weight:
    • 285.232

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality