Difference between revisions of "5Z13E-15S-1115-DIHYDROXY-9-OXOPROS"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=ExchangeSeed-CARBON-DIOXIDE ExchangeSeed-CARBON-DIOXIDE] == * direction: ** reversible == Reaction...")
(Created page with "Category:metabolite == Metabolite 5Z13E-15S-1115-DIHYDROXY-9-OXOPROS == * common-name: ** prostaglandin e2 * smiles: ** cccccc(o)c=cc1(c(cc=ccccc(=o)[o-])c(=o)cc(o)1) * in...")
 
(7 intermediate revisions by 2 users not shown)
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=ExchangeSeed-CARBON-DIOXIDE ExchangeSeed-CARBON-DIOXIDE] ==
+
== Metabolite 5Z13E-15S-1115-DIHYDROXY-9-OXOPROS ==
−
* direction:
+
* common-name:
−
** reversible
+
** prostaglandin e2
−
== Reaction formula ==
+
* smiles:
−
* 1.0 [[CARBON-DIOXIDE]][C-BOUNDARY] '''<=>''' 1.0 [[CARBON-DIOXIDE]][e]
+
** cccccc(o)c=cc1(c(cc=ccccc(=o)[o-])c(=o)cc(o)1)
−
== Gene(s) associated with this reaction  ==
+
* inchi-key:
−
== Pathway(s)  ==
+
** xeybrnlfezdvaw-arsrfyassa-m
−
== Reconstruction information  ==
+
* molecular-weight:
−
* category: [[manual]]; source: [[import_from_medium]]; tool: [[curation]]; comment: added to manage seeds from boundary to extracellular compartment
+
** 351.462
−
== External links  ==
+
== Reaction(s) known to consume the compound ==
−
{{#set: direction=reversible}}
+
* [[1.1.1.141-RXN]]
−
{{#set: nb gene associated=0}}
+
* [[PROSTAGLANDIN-E2-9-REDUCTASE-RXN]]
−
{{#set: nb pathway associated=0}}
+
== Reaction(s) known to produce the compound ==
−
{{#set: reconstruction category=manual}}
+
* [[1.1.1.141-RXN]]
−
{{#set: reconstruction tool=curation}}
+
* [[PROSTAGLANDIN-E-SYNTHASE-RXN]]
−
{{#set: reconstruction comment=added to manage seeds from boundary to extracellular compartment}}
+
* [[PROSTAGLANDIN-E2-9-REDUCTASE-RXN]]
−
{{#set: reconstruction source=import_from_medium}}
+
== Reaction(s) of unknown directionality ==
 +
{{#set: common-name=prostaglandin e2}}
 +
{{#set: inchi-key=inchikey=xeybrnlfezdvaw-arsrfyassa-m}}
 +
{{#set: molecular-weight=351.462}}

Latest revision as of 11:16, 18 March 2021

Metabolite 5Z13E-15S-1115-DIHYDROXY-9-OXOPROS

  • common-name:
    • prostaglandin e2
  • smiles:
    • cccccc(o)c=cc1(c(cc=ccccc(=o)[o-])c(=o)cc(o)1)
  • inchi-key:
    • xeybrnlfezdvaw-arsrfyassa-m
  • molecular-weight:
    • 351.462

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=5Z13E-15S-1115-DIHYDROXY-9-OXOPROS&oldid=138886"