Difference between revisions of "5Z13E-15S-1115-DIHYDROXY-9-OXOPROS"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-374 == * common-name: ** sepiapterin * smiles: ** cc(o)c(=o)c1(cnc2(n=c(n)nc(=o)c(n=1)=2)) * inchi-key: ** vpvoxuspxfpwbn-vkhmyheasa-...")
(Created page with "Category:metabolite == Metabolite 5Z13E-15S-1115-DIHYDROXY-9-OXOPROS == * common-name: ** prostaglandin e2 * smiles: ** cccccc(o)c=cc1(c(cc=ccccc(=o)[o-])c(=o)cc(o)1) * in...")
 
(4 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-374 ==
+
== Metabolite 5Z13E-15S-1115-DIHYDROXY-9-OXOPROS ==
 
* common-name:
 
* common-name:
** sepiapterin
+
** prostaglandin e2
 
* smiles:
 
* smiles:
** cc(o)c(=o)c1(cnc2(n=c(n)nc(=o)c(n=1)=2))
+
** cccccc(o)c=cc1(c(cc=ccccc(=o)[o-])c(=o)cc(o)1)
 
* inchi-key:
 
* inchi-key:
** vpvoxuspxfpwbn-vkhmyheasa-n
+
** xeybrnlfezdvaw-arsrfyassa-m
 
* molecular-weight:
 
* molecular-weight:
** 237.218
+
** 351.462
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[SEPIAPTERIN-REDUCTASE-RXN]]
+
* [[1.1.1.141-RXN]]
 +
* [[PROSTAGLANDIN-E2-9-REDUCTASE-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[SEPIAPTERIN-REDUCTASE-RXN]]
+
* [[1.1.1.141-RXN]]
 +
* [[PROSTAGLANDIN-E-SYNTHASE-RXN]]
 +
* [[PROSTAGLANDIN-E2-9-REDUCTASE-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=sepiapterin}}
+
{{#set: common-name=prostaglandin e2}}
{{#set: inchi-key=inchikey=vpvoxuspxfpwbn-vkhmyheasa-n}}
+
{{#set: inchi-key=inchikey=xeybrnlfezdvaw-arsrfyassa-m}}
{{#set: molecular-weight=237.218}}
+
{{#set: molecular-weight=351.462}}

Latest revision as of 11:16, 18 March 2021

Metabolite 5Z13E-15S-1115-DIHYDROXY-9-OXOPROS

  • common-name:
    • prostaglandin e2
  • smiles:
    • cccccc(o)c=cc1(c(cc=ccccc(=o)[o-])c(=o)cc(o)1)
  • inchi-key:
    • xeybrnlfezdvaw-arsrfyassa-m
  • molecular-weight:
    • 351.462

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality