Difference between revisions of "5Z13E-15S-1115-DIHYDROXY-9-OXOPROS"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-195 == * common-name: ** octanoate * smiles: ** cccccccc(=o)[o-] * inchi-key: ** wwzkqhockizlma-uhfffaoysa-m * molecular-weight: ** 1...")
(Created page with "Category:metabolite == Metabolite 5Z13E-15S-1115-DIHYDROXY-9-OXOPROS == * common-name: ** prostaglandin e2 * smiles: ** cccccc(o)c=cc1(c(cc=ccccc(=o)[o-])c(=o)cc(o)1) * in...")
 
(3 intermediate revisions by one other user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
−
== Metabolite CPD-195 ==
+
== Metabolite 5Z13E-15S-1115-DIHYDROXY-9-OXOPROS ==
 
* common-name:
 
* common-name:
−
** octanoate
+
** prostaglandin e2
 
* smiles:
 
* smiles:
−
** cccccccc(=o)[o-]
+
** cccccc(o)c=cc1(c(cc=ccccc(=o)[o-])c(=o)cc(o)1)
 
* inchi-key:
 
* inchi-key:
−
** wwzkqhockizlma-uhfffaoysa-m
+
** xeybrnlfezdvaw-arsrfyassa-m
 
* molecular-weight:
 
* molecular-weight:
−
** 143.205
+
** 351.462
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
−
* [[R223-RXN]]
+
* [[1.1.1.141-RXN]]
−
* [[RXN0-5098]]
+
* [[PROSTAGLANDIN-E2-9-REDUCTASE-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
−
* [[3.1.2.19-RXN-CPD-196/WATER//CPD-195/CO-A/PROTON.35.]]
+
* [[1.1.1.141-RXN]]
−
* [[ACECOATRANS-RXN-CPD-196/ACET//CPD-195/ACETYL-COA.33.]]
+
* [[PROSTAGLANDIN-E-SYNTHASE-RXN]]
−
* [[R222-RXN]]
+
* [[PROSTAGLANDIN-E2-9-REDUCTASE-RXN]]
−
* [[THIOESTER-RXN[CCO-CYTOSOL]-CPD-196/WATER//CPD-195/CO-A/PROTON.48.]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
−
{{#set: common-name=octanoate}}
+
{{#set: common-name=prostaglandin e2}}
−
{{#set: inchi-key=inchikey=wwzkqhockizlma-uhfffaoysa-m}}
+
{{#set: inchi-key=inchikey=xeybrnlfezdvaw-arsrfyassa-m}}
−
{{#set: molecular-weight=143.205}}
+
{{#set: molecular-weight=351.462}}

Latest revision as of 11:16, 18 March 2021

Metabolite 5Z13E-15S-1115-DIHYDROXY-9-OXOPROS

  • common-name:
    • prostaglandin e2
  • smiles:
    • cccccc(o)c=cc1(c(cc=ccccc(=o)[o-])c(=o)cc(o)1)
  • inchi-key:
    • xeybrnlfezdvaw-arsrfyassa-m
  • molecular-weight:
    • 351.462

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=5Z13E-15S-1115-DIHYDROXY-9-OXOPROS&oldid=138886"