Difference between revisions of "5Z13E-15S-1115-DIHYDROXY-9-OXOPROS"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite 3-hydroxy-cis-D7-tetraecenoyl-ACPs == * common-name: ** a (3r)-3-hydroxy cis δ7-tetradecenoyl-[acp] == Reaction(s) known to consume...") |
(Created page with "Category:metabolite == Metabolite 5Z13E-15S-1115-DIHYDROXY-9-OXOPROS == * common-name: ** prostaglandin e2 * smiles: ** cccccc(o)c=cc1(c(cc=ccccc(=o)[o-])c(=o)cc(o)1) * in...") |
||
(2 intermediate revisions by one other user not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite 5Z13E-15S-1115-DIHYDROXY-9-OXOPROS == |
* common-name: | * common-name: | ||
− | ** | + | ** prostaglandin e2 |
+ | * smiles: | ||
+ | ** cccccc(o)c=cc1(c(cc=ccccc(=o)[o-])c(=o)cc(o)1) | ||
+ | * inchi-key: | ||
+ | ** xeybrnlfezdvaw-arsrfyassa-m | ||
+ | * molecular-weight: | ||
+ | ** 351.462 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[RXN- | + | * [[1.1.1.141-RXN]] |
+ | * [[PROSTAGLANDIN-E2-9-REDUCTASE-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[RXN- | + | * [[1.1.1.141-RXN]] |
+ | * [[PROSTAGLANDIN-E-SYNTHASE-RXN]] | ||
+ | * [[PROSTAGLANDIN-E2-9-REDUCTASE-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=prostaglandin e2}} |
+ | {{#set: inchi-key=inchikey=xeybrnlfezdvaw-arsrfyassa-m}} | ||
+ | {{#set: molecular-weight=351.462}} |
Latest revision as of 11:16, 18 March 2021
Contents
Metabolite 5Z13E-15S-1115-DIHYDROXY-9-OXOPROS
- common-name:
- prostaglandin e2
- smiles:
- cccccc(o)c=cc1(c(cc=ccccc(=o)[o-])c(=o)cc(o)1)
- inchi-key:
- xeybrnlfezdvaw-arsrfyassa-m
- molecular-weight:
- 351.462