Difference between revisions of "5Z13E-15S-9-ALPHA11-ALPHA15-TRIHY"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-7003 == * common-name: ** tetrahydrogeranylgeranyl diphosphate * smiles: ** cc(=cccc(cccc(cccc(=ccop([o-])(=o)op([o-])(=o)[o-])c)c)c)...") |
(Created page with "Category:metabolite == Metabolite CPD-11497 == * common-name: ** 3-methoxy-4-hydroxyphenylglycol * smiles: ** coc1(=c(o)c=cc(c(o)co)=c1) * inchi-key: ** fbwpwwwzwkpjfl-qmm...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite CPD- | + | == Metabolite CPD-11497 == |
* common-name: | * common-name: | ||
| − | ** | + | ** 3-methoxy-4-hydroxyphenylglycol |
* smiles: | * smiles: | ||
| − | ** | + | ** coc1(=c(o)c=cc(c(o)co)=c1) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** fbwpwwwzwkpjfl-qmmmgpobsa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 184.191 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[RXN-10915]] |
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[RXN-10915]] |
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=3-methoxy-4-hydroxyphenylglycol}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=fbwpwwwzwkpjfl-qmmmgpobsa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=184.191}} |
Revision as of 15:26, 5 January 2021
Contents
Metabolite CPD-11497
- common-name:
- 3-methoxy-4-hydroxyphenylglycol
- smiles:
- coc1(=c(o)c=cc(c(o)co)=c1)
- inchi-key:
- fbwpwwwzwkpjfl-qmmmgpobsa-n
- molecular-weight:
- 184.191
