Difference between revisions of "5Z13E-15S-9-ALPHA11-ALPHA15-TRIHY"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-11497 == * common-name: ** 3-methoxy-4-hydroxyphenylglycol * smiles: ** coc1(=c(o)c=cc(c(o)co)=c1) * inchi-key: ** fbwpwwwzwkpjfl-qmm...") |
(Created page with "Category:metabolite == Metabolite BUTANOL == * common-name: ** butan-1-ol * smiles: ** cccco * inchi-key: ** lrhpldygymqrhn-uhfffaoysa-n * molecular-weight: ** 74.122 == R...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite BUTANOL == |
* common-name: | * common-name: | ||
− | ** | + | ** butan-1-ol |
* smiles: | * smiles: | ||
− | ** | + | ** cccco |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** lrhpldygymqrhn-uhfffaoysa-n |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 74.122 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[RXN- | + | * [[RXN-161]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[RXN- | + | * [[BTS_LPAREN_nadph_RPAREN_]] |
+ | * [[RXN-161]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=butan-1-ol}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=lrhpldygymqrhn-uhfffaoysa-n}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=74.122}} |
Revision as of 13:08, 14 January 2021
Contents
Metabolite BUTANOL
- common-name:
- butan-1-ol
- smiles:
- cccco
- inchi-key:
- lrhpldygymqrhn-uhfffaoysa-n
- molecular-weight:
- 74.122