Difference between revisions of "5Z13E-15S-9-ALPHA15-DIHYDROXY-11-O"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ20478 == * transcription-direction: ** negative * right-end-position: ** 313109 * left-end-position: ** 310639 * centisome-position: ** 50.26334...")
(Created page with "Category:metabolite == Metabolite 5Z13E-15S-9-ALPHA15-DIHYDROXY-11-O == * common-name: ** prostaglandin d2 * smiles: ** cccccc(o)c=cc1(c(=o)cc(o)c(cc=ccccc(=o)[o-])1) * in...")
 
(7 intermediate revisions by 3 users not shown)
Line 1: Line 1:
−
[[Category:gene]]
+
[[Category:metabolite]]
−
== Gene SJ20478 ==
+
== Metabolite 5Z13E-15S-9-ALPHA15-DIHYDROXY-11-O ==
−
* transcription-direction:
+
* common-name:
−
** negative
+
** prostaglandin d2
−
* right-end-position:
+
* smiles:
−
** 313109
+
** cccccc(o)c=cc1(c(=o)cc(o)c(cc=ccccc(=o)[o-])1)
−
* left-end-position:
+
* inchi-key:
−
** 310639
+
** bhmbvrspmrccgg-outuxvnysa-m
−
* centisome-position:
+
* molecular-weight:
−
** 50.26334   
+
** 351.462
−
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
−
* [[S.japonica_carotenoid_curated]]
+
* [[1.1.1.188-RXN]]
−
== Reaction(s) associated ==
+
== Reaction(s) known to produce the compound ==
−
* [[PEPTIDYLPROLYL-ISOMERASE-RXN]]
+
* [[1.1.1.188-RXN]]
−
** Category: [[annotation]]
+
* [[PROSTAGLANDIN-D-SYNTHASE-RXN]]
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
== Reaction(s) of unknown directionality ==
−
** Category: [[orthology]]
+
{{#set: common-name=prostaglandin d2}}
−
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
+
{{#set: inchi-key=inchikey=bhmbvrspmrccgg-outuxvnysa-m}}
−
{{#set: transcription-direction=negative}}
+
{{#set: molecular-weight=351.462}}
−
{{#set: right-end-position=313109}}
 
−
{{#set: left-end-position=310639}}
 
−
{{#set: centisome-position=50.26334    }}
 
−
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
−
{{#set: nb reaction associated=1}}
 

Latest revision as of 11:13, 18 March 2021

Metabolite 5Z13E-15S-9-ALPHA15-DIHYDROXY-11-O

  • common-name:
    • prostaglandin d2
  • smiles:
    • cccccc(o)c=cc1(c(=o)cc(o)c(cc=ccccc(=o)[o-])1)
  • inchi-key:
    • bhmbvrspmrccgg-outuxvnysa-m
  • molecular-weight:
    • 351.462

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=5Z13E-15S-9-ALPHA15-DIHYDROXY-11-O&oldid=137750"