Difference between revisions of "5Z8Z11Z13E-15S-15-HYDROPEROXYICOS"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite TREHALOSE == * common-name: ** α,α-trehalose * smiles: ** c(c1(oc(c(c(c1o)o)o)oc2(c(c(c(c(o2)co)o)o)o)))o * inchi-key: ** hdt...")
(Created page with "Category:metabolite == Metabolite 5Z8Z11Z13E-15S-15-HYDROPEROXYICOS == * common-name: ** (15s)-hpete * smiles: ** cccccc(oo)c=cc=ccc=ccc=ccccc(=o)[o-] * inchi-key: ** bfwy...")
 
(2 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite TREHALOSE ==
+
== Metabolite 5Z8Z11Z13E-15S-15-HYDROPEROXYICOS ==
 
* common-name:
 
* common-name:
** α,α-trehalose
+
** (15s)-hpete
 
* smiles:
 
* smiles:
** c(c1(oc(c(c(c1o)o)o)oc2(c(c(c(c(o2)co)o)o)o)))o
+
** cccccc(oo)c=cc=ccc=ccc=ccccc(=o)[o-]
 
* inchi-key:
 
* inchi-key:
** hdtrylnuvzcqoy-lizsdcnhsa-n
+
** bfwytordsfivkp-vaeksgalsa-m
 
* molecular-weight:
 
* molecular-weight:
** 342.299
+
** 335.462
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[TREHALA-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[TREHALOSEPHOSPHA-RXN]]
+
* [[ARACHIDONATE-15-LIPOXYGENASE-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=α,α-trehalose}}
+
{{#set: common-name=(15s)-hpete}}
{{#set: inchi-key=inchikey=hdtrylnuvzcqoy-lizsdcnhsa-n}}
+
{{#set: inchi-key=inchikey=bfwytordsfivkp-vaeksgalsa-m}}
{{#set: molecular-weight=342.299}}
+
{{#set: molecular-weight=335.462}}

Latest revision as of 11:13, 18 March 2021

Metabolite 5Z8Z11Z13E-15S-15-HYDROPEROXYICOS

  • common-name:
    • (15s)-hpete
  • smiles:
    • cccccc(oo)c=cc=ccc=ccc=ccccc(=o)[o-]
  • inchi-key:
    • bfwytordsfivkp-vaeksgalsa-m
  • molecular-weight:
    • 335.462

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality