Difference between revisions of "5Z8Z11Z13E-15S-15-HYDROPEROXYICOS"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-14407 == * common-name: ** dihomo γ-linolenoyl-coa * smiles: ** cccccc=ccc=ccc=cccccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(...")
(Created page with "Category:metabolite == Metabolite CPD-1137 == * common-name: ** itaconyl-coa * smiles: ** c=c(cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-14407 ==
+
== Metabolite CPD-1137 ==
 
* common-name:
 
* common-name:
** dihomo γ-linolenoyl-coa
+
** itaconyl-coa
 
* smiles:
 
* smiles:
** cccccc=ccc=ccc=cccccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
+
** c=c(cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o)c([o-])=o
 
* inchi-key:
 
* inchi-key:
** fjwjalrunnzibb-ddquopdjsa-j
+
** nfvgylgssjprkw-citakdkdsa-i
 
* molecular-weight:
 
* molecular-weight:
** 1051.975
+
** 874.579
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-13435]]
 
* [[RXN-16044]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-12971]]
+
* [[RXN-8988]]
* [[RXN-17105]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=dihomo γ-linolenoyl-coa}}
+
{{#set: common-name=itaconyl-coa}}
{{#set: inchi-key=inchikey=fjwjalrunnzibb-ddquopdjsa-j}}
+
{{#set: inchi-key=inchikey=nfvgylgssjprkw-citakdkdsa-i}}
{{#set: molecular-weight=1051.975}}
+
{{#set: molecular-weight=874.579}}

Revision as of 13:09, 14 January 2021

Metabolite CPD-1137

  • common-name:
    • itaconyl-coa
  • smiles:
    • c=c(cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o)c([o-])=o
  • inchi-key:
    • nfvgylgssjprkw-citakdkdsa-i
  • molecular-weight:
    • 874.579

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality