Difference between revisions of "5Z8Z11Z14Z17Z-EICOSAPENTAENOATE"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ03446 == * transcription-direction: ** positive * right-end-position: ** 79434 * left-end-position: ** 70275 * centisome-position: ** 58.11934...") |
(Created page with "Category:metabolite == Metabolite 5Z8Z11Z14Z17Z-EICOSAPENTAENOATE == * common-name: ** icosapentaenoate * smiles: ** ccc=ccc=ccc=ccc=ccc=ccccc(=o)[o-] * inchi-key: ** jazb...") |
||
(7 intermediate revisions by 3 users not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite 5Z8Z11Z14Z17Z-EICOSAPENTAENOATE == |
− | * | + | * common-name: |
− | ** | + | ** icosapentaenoate |
− | * | + | * smiles: |
− | ** | + | ** ccc=ccc=ccc=ccc=ccc=ccccc(=o)[o-] |
− | * | + | * inchi-key: |
− | ** | + | ** jazbehyotptenj-jlnkqsitsa-m |
− | * | + | * molecular-weight: |
− | ** | + | ** 301.448 |
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[ | + | * [[RXN-12978]] |
− | == Reaction(s) | + | == Reaction(s) known to produce the compound == |
− | + | * [[RXN-13430]] | |
− | * [[ | + | * [[RXN-13431]] |
− | + | * [[RXN-16139]] | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | {{#set: common-name=icosapentaenoate}} | |
− | + | {{#set: inchi-key=inchikey=jazbehyotptenj-jlnkqsitsa-m}} | |
− | + | {{#set: molecular-weight=301.448}} | |
− | |||
− | |||
− | |||
− | * [[RXN- | ||
− | |||
− | |||
− | * [[RXN- | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == | ||
− | |||
− | |||
− | |||
− | |||
− | {{#set: | ||
− | {{#set: | ||
− | |||
− | {{#set: | ||
− | |||
− | |||
− |
Latest revision as of 11:11, 18 March 2021
Contents
Metabolite 5Z8Z11Z14Z17Z-EICOSAPENTAENOATE
- common-name:
- icosapentaenoate
- smiles:
- ccc=ccc=ccc=ccc=ccc=ccccc(=o)[o-]
- inchi-key:
- jazbehyotptenj-jlnkqsitsa-m
- molecular-weight:
- 301.448