Difference between revisions of "6-Dimethylallyladenosine37-tRNAs"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite 4-AMINO-4-DEOXYCHORISMATE == * common-name: ** 4-amino-4-deoxychorismate * smiles: ** c=c(c(=o)[o-])oc1(c([n+])c=cc(c([o-])=o)=c1) * inch...") |
(Created page with "Category:metabolite == Metabolite 6-Dimethylallyladenosine37-tRNAs == * common-name: ** n6-dimethylallyladenosine37 in trna == Reaction(s) known to consume the compound ==...") |
||
| (5 intermediate revisions by 3 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite 6-Dimethylallyladenosine37-tRNAs == |
* common-name: | * common-name: | ||
| − | ** | + | ** n6-dimethylallyladenosine37 in trna |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN-14480]] |
| − | * [[ | + | * [[RXN0-5063]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN0-6274]] |
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=n6-dimethylallyladenosine37 in trna}} |
| − | |||
| − | |||
Latest revision as of 11:17, 18 March 2021
Contents
Metabolite 6-Dimethylallyladenosine37-tRNAs
- common-name:
- n6-dimethylallyladenosine37 in trna
