Difference between revisions of "6-Dimethylallyladenosine37-tRNAs"
Jump to navigation
Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=AMP5N AMP5N] == * direction: ** left-to-right * common-name: ** amp-5'-nucleotidase == Reaction for...") |
(Created page with "Category:metabolite == Metabolite 4-AMINO-4-DEOXYCHORISMATE == * common-name: ** 4-amino-4-deoxychorismate * smiles: ** c=c(c(=o)[o-])oc1(c([n+])c=cc(c([o-])=o)=c1) * inch...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:metabolite]] |
| − | == | + | == Metabolite 4-AMINO-4-DEOXYCHORISMATE == |
| − | |||
| − | |||
* common-name: | * common-name: | ||
| − | ** | + | ** 4-amino-4-deoxychorismate |
| − | + | * smiles: | |
| − | * | + | ** c=c(c(=o)[o-])oc1(c([n+])c=cc(c([o-])=o)=c1) |
| − | = | + | * inchi-key: |
| − | * | + | ** oiujhgolfkdbsu-htqzyqbosa-m |
| − | ** | + | * molecular-weight: |
| − | *** | + | ** 224.193 |
| − | == | + | == Reaction(s) known to consume the compound == |
| − | + | * [[ADCLY-RXN]] | |
| − | * | + | * [[PABASYN-RXN]] |
| − | == | + | == Reaction(s) known to produce the compound == |
| − | + | * [[ADCLY-RXN]] | |
| − | {{#set: common-name= | + | * [[PABASYN-RXN]] |
| − | {{#set: | + | == Reaction(s) of unknown directionality == |
| − | + | {{#set: common-name=4-amino-4-deoxychorismate}} | |
| − | {{#set: | + | {{#set: inchi-key=inchikey=oiujhgolfkdbsu-htqzyqbosa-m}} |
| − | + | {{#set: molecular-weight=224.193}} | |
| − | |||
| − | |||
Revision as of 20:37, 18 December 2020
Contents
Metabolite 4-AMINO-4-DEOXYCHORISMATE
- common-name:
- 4-amino-4-deoxychorismate
- smiles:
- c=c(c(=o)[o-])oc1(c([n+])c=cc(c([o-])=o)=c1)
- inchi-key:
- oiujhgolfkdbsu-htqzyqbosa-m
- molecular-weight:
- 224.193
