Difference between revisions of "6-PYRUVOYL-5678-TETRAHYDROPTERIN"

Revision as of 11:19, 15 January 2021

@@ Line 1: / Line 1: @@
 [[Category:metabolite]]
-== Metabolite CPD-14925 ==
+== Metabolite ADENINE ==
 * common-name:
-** (3z)-dec-3-enoyl-coa
+** adenine
 * smiles:
-** ccccccc=ccc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o
+** c1(n)(n=cn=c2(nc=nc=12))
 * inchi-key:
-** cqgvnmqhzqjnii-uusbzyposa-j
+** gffgjbxgbjisgv-uhfffaoysa-n
 * molecular-weight:
-** 915.738
+** 135.128
 == Reaction(s) known to consume the compound ==
+* [[1.5.99.12-RXN]]
+* [[ADENPHOSPHOR-RXN]]
+* [[ADENPRIBOSYLTRAN-RXN]]
+* [[APPRT]]
+* [[DEOXYADENPHOSPHOR-RXN]]
 == Reaction(s) known to produce the compound ==
-* [[RXN-17799]]
+* [[1.5.99.12-RXN]]
+* [[ADENOSYLHOMOCYSTEINE-NUCLEOSIDASE-RXN]]
+* [[ADENPHOSPHOR-RXN]]
+* [[APPRT]]
+* [[DEOXYADENPHOSPHOR-RXN]]
+* [[M5TAP]]
+* [[METHYLTHIOADENOSINE-NUCLEOSIDASE-RXN]]
+* [[RXN-11715]]
+* [[RXN-11743]]
+* [[RXN0-984]]
 == Reaction(s) of unknown directionality ==
-{{#set: common-name=(3z)-dec-3-enoyl-coa}}
+{{#set: common-name=adenine}}
-{{#set: inchi-key=inchikey=cqgvnmqhzqjnii-uusbzyposa-j}}
+{{#set: inchi-key=inchikey=gffgjbxgbjisgv-uhfffaoysa-n}}
-{{#set: molecular-weight=915.738}}
+{{#set: molecular-weight=135.128}}