Difference between revisions of "6-PYRUVOYL-5678-TETRAHYDROPTERIN"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-14925 == * common-name: ** (3z)-dec-3-enoyl-coa * smiles: ** ccccccc=ccc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=...")
(Created page with "Category:metabolite == Metabolite 6-PYRUVOYL-5678-TETRAHYDROPTERIN == * common-name: ** (6r)-6-pyruvoyl-5,6,7,8-tetrahydropterin * smiles: ** cc(=o)c(=o)[ch]1(cnc2(n=c(n)n...")
 
(2 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-14925 ==
+
== Metabolite 6-PYRUVOYL-5678-TETRAHYDROPTERIN ==
 
* common-name:
 
* common-name:
** (3z)-dec-3-enoyl-coa
+
** (6r)-6-pyruvoyl-5,6,7,8-tetrahydropterin
 
* smiles:
 
* smiles:
** ccccccc=ccc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o
+
** cc(=o)c(=o)[ch]1(cnc2(n=c(n)nc(=o)c(n1)=2))
 
* inchi-key:
 
* inchi-key:
** cqgvnmqhzqjnii-uusbzyposa-j
+
** wbjzxbuveczhce-scsaibsysa-n
 
* molecular-weight:
 
* molecular-weight:
** 915.738
+
** 237.218
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-8853]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-17799]]
+
* [[4.2.3.12-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(3z)-dec-3-enoyl-coa}}
+
{{#set: common-name=(6r)-6-pyruvoyl-5,6,7,8-tetrahydropterin}}
{{#set: inchi-key=inchikey=cqgvnmqhzqjnii-uusbzyposa-j}}
+
{{#set: inchi-key=inchikey=wbjzxbuveczhce-scsaibsysa-n}}
{{#set: molecular-weight=915.738}}
+
{{#set: molecular-weight=237.218}}

Latest revision as of 11:17, 18 March 2021

Metabolite 6-PYRUVOYL-5678-TETRAHYDROPTERIN

  • common-name:
    • (6r)-6-pyruvoyl-5,6,7,8-tetrahydropterin
  • smiles:
    • cc(=o)c(=o)[ch]1(cnc2(n=c(n)nc(=o)c(n1)=2))
  • inchi-key:
    • wbjzxbuveczhce-scsaibsysa-n
  • molecular-weight:
    • 237.218

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality