Difference between revisions of "6-PYRUVOYL-5678-TETRAHYDROPTERIN"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-13853 == * common-name: ** 8-oxo-dgdp * smiles: ** c(op(=o)([o-])op(=o)([o-])[o-])c1(oc(cc(o)1)n3(c(=o)nc2(c(=o)nc(n)=nc=23))) * inch...") |
(Created page with "Category:metabolite == Metabolite 6-PYRUVOYL-5678-TETRAHYDROPTERIN == * common-name: ** (6r)-6-pyruvoyl-5,6,7,8-tetrahydropterin * smiles: ** cc(=o)c(=o)[ch]1(cnc2(n=c(n)n...") |
||
(6 intermediate revisions by 3 users not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite 6-PYRUVOYL-5678-TETRAHYDROPTERIN == |
* common-name: | * common-name: | ||
− | ** 8- | + | ** (6r)-6-pyruvoyl-5,6,7,8-tetrahydropterin |
* smiles: | * smiles: | ||
− | ** | + | ** cc(=o)c(=o)[ch]1(cnc2(n=c(n)nc(=o)c(n1)=2)) |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** wbjzxbuveczhce-scsaibsysa-n |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 237.218 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[RXN- | + | * [[RXN-8853]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[4.2.3.12-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name=8- | + | {{#set: common-name=(6r)-6-pyruvoyl-5,6,7,8-tetrahydropterin}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=wbjzxbuveczhce-scsaibsysa-n}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=237.218}} |
Latest revision as of 11:17, 18 March 2021
Contents
Metabolite 6-PYRUVOYL-5678-TETRAHYDROPTERIN
- common-name:
- (6r)-6-pyruvoyl-5,6,7,8-tetrahydropterin
- smiles:
- cc(=o)c(=o)[ch]1(cnc2(n=c(n)nc(=o)c(n1)=2))
- inchi-key:
- wbjzxbuveczhce-scsaibsysa-n
- molecular-weight:
- 237.218