Difference between revisions of "6Z8E10E14Z-5S12R-512-DIHYDROXYI"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ17981 == * transcription-direction: ** positive * right-end-position: ** 72750 * left-end-position: ** 48843 * centisome-position: ** 19.278332...") |
(Created page with "Category:metabolite == Metabolite 6Z8E10E14Z-5S12R-512-DIHYDROXYI == * common-name: ** leukotriene b4 * smiles: ** cccccc=ccc(o)c=cc=cc=cc(o)cccc(=o)[o-] * inchi-key: ** v...") |
||
| (9 intermediate revisions by 4 users not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:metabolite]] |
| − | == | + | == Metabolite 6Z8E10E14Z-5S12R-512-DIHYDROXYI == |
| − | * | + | * common-name: |
| − | ** | + | ** leukotriene b4 |
| − | * | + | * smiles: |
| − | ** | + | ** cccccc=ccc(o)c=cc=cc=cc(o)cccc(=o)[o-] |
| − | * | + | * inchi-key: |
| − | ** | + | ** vnyssyrcgwbhlg-amolwhmgsa-m |
| − | * | + | * molecular-weight: |
| − | ** | + | ** 335.462 |
| − | == | + | == Reaction(s) known to consume the compound == |
| − | + | == Reaction(s) known to produce the compound == | |
| − | == Reaction(s) | + | * [[LEUKOTRIENE-A4-HYDROLASE-RXN]] |
| − | * [[ | + | == Reaction(s) of unknown directionality == |
| − | + | {{#set: common-name=leukotriene b4}} | |
| − | + | {{#set: inchi-key=inchikey=vnyssyrcgwbhlg-amolwhmgsa-m}} | |
| − | + | {{#set: molecular-weight=335.462}} | |
| − | |||
| − | |||
| − | == | ||
| − | |||
| − | |||
| − | {{#set: | ||
| − | {{#set: | ||
| − | |||
| − | {{#set: | ||
| − | |||
| − | |||
| − | |||
Latest revision as of 11:12, 18 March 2021
Contents
Metabolite 6Z8E10E14Z-5S12R-512-DIHYDROXYI
- common-name:
- leukotriene b4
- smiles:
- cccccc=ccc(o)c=cc=cc=cc(o)cccc(=o)[o-]
- inchi-key:
- vnyssyrcgwbhlg-amolwhmgsa-m
- molecular-weight:
- 335.462
