Difference between revisions of "6Z8E10E14Z-5S12R-512-DIHYDROXYI"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-692 == * common-name: ** (+)-cis-abscisic aldehyde * smiles: ** cc(=cc=o)c=cc1(c(c)(c)cc(=o)c=c(c)1)o * inchi-key: ** rikwdzwvhuiuam-...")
(Created page with "Category:metabolite == Metabolite Non-Fucosylated-Fucose-Acceptors == * common-name: ** a non fucosylated fucose acceptor == Reaction(s) known to consume the compound == =...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-692 ==
+
== Metabolite Non-Fucosylated-Fucose-Acceptors ==
 
* common-name:
 
* common-name:
** (+)-cis-abscisic aldehyde
+
** a non fucosylated fucose acceptor
* smiles:
 
** cc(=cc=o)c=cc1(c(c)(c)cc(=o)c=c(c)1)o
 
* inchi-key:
 
** rikwdzwvhuiuam-kicrzjjpsa-n
 
* molecular-weight:
 
** 248.321
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[1.2.3.14-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[1.1.1.288-RXN]]
+
* [[3.2.1.38-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(+)-cis-abscisic aldehyde}}
+
{{#set: common-name=a non fucosylated fucose acceptor}}
{{#set: inchi-key=inchikey=rikwdzwvhuiuam-kicrzjjpsa-n}}
 
{{#set: molecular-weight=248.321}}
 

Revision as of 13:09, 14 January 2021

Metabolite Non-Fucosylated-Fucose-Acceptors

  • common-name:
    • a non fucosylated fucose acceptor

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality