Difference between revisions of "7-AMINOMETHYL-7-DEAZAGUANINE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-4125 == * common-name: ** avenasterol * smiles: ** cc=c(c(c)c)ccc(c)[ch]3(cc[ch]4(c2(=cc[ch]1(cc(o)ccc(c)1[ch]2ccc(c)34)))) * inchi-k...") |
(Created page with "Category:metabolite == Metabolite 7-AMINOMETHYL-7-DEAZAGUANINE == * common-name: ** preq1 * smiles: ** c([n+])c2(c1(c(=o)nc(n)=nc=1nc=2)) * inchi-key: ** meymblgokydglz-uh...") |
||
| (6 intermediate revisions by 3 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite 7-AMINOMETHYL-7-DEAZAGUANINE == |
* common-name: | * common-name: | ||
| − | ** | + | ** preq1 |
* smiles: | * smiles: | ||
| − | ** | + | ** c([n+])c2(c1(c(=o)nc(n)=nc=1nc=2)) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** meymblgokydglz-uhfffaoysa-o |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 180.189 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN0-1321]] |
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=preq1}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=meymblgokydglz-uhfffaoysa-o}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=180.189}} |
Latest revision as of 11:14, 18 March 2021
Contents
Metabolite 7-AMINOMETHYL-7-DEAZAGUANINE
- common-name:
- preq1
- smiles:
- c([n+])c2(c1(c(=o)nc(n)=nc=1nc=2))
- inchi-key:
- meymblgokydglz-uhfffaoysa-o
- molecular-weight:
- 180.189
