Difference between revisions of "7-METHYLGUANOSINE-5-PHOSPHATE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN0-6952 RXN0-6952] == * direction: ** left-to-right * common-name: ** phosphatidylcholine 1-acylh...")
(Created page with "Category:metabolite == Metabolite 7-METHYLGUANOSINE-5-PHOSPHATE == * common-name: ** n7-methylguanosine 5'-phosphate * smiles: ** c[n+]1(=cn(c2(n=c(n)nc(=o)c1=2))c3(oc(cop...")
 
(8 intermediate revisions by 4 users not shown)
Line 1: Line 1:
[[Category:reaction]]
+
[[Category:metabolite]]
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN0-6952 RXN0-6952] ==
+
== Metabolite 7-METHYLGUANOSINE-5-PHOSPHATE ==
* direction:
 
** left-to-right
 
 
* common-name:
 
* common-name:
** phosphatidylcholine 1-acylhydrolase
+
** n7-methylguanosine 5'-phosphate
** phospholipase a1
+
* smiles:
* ec-number:
+
** c[n+]1(=cn(c2(n=c(n)nc(=o)c1=2))c3(oc(cop(=o)([o-])[o-])c(o)c(o)3))
** [http://enzyme.expasy.org/EC/3.1.1.32 ec-3.1.1.32]
+
* inchi-key:
== Reaction formula ==
+
** aokqnzvjjxpuqa-kqynxxcusa-m
* 1 [[L-1-PHOSPHATIDYL-ETHANOLAMINE]][c] '''+''' 1 [[WATER]][c] '''=>''' 1 [[2-ACYL-GPE]][c] '''+''' 1 [[Fatty-Acids]][c] '''+''' 1 [[PROTON]][c]
+
* molecular-weight:
== Gene(s) associated with this reaction  ==
+
** 376.242
* Gene: [[SJ01382]]
+
== Reaction(s) known to consume the compound ==
** Category: [[annotation]]
+
* [[RXN-12826]]
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
+
== Reaction(s) known to produce the compound ==
* Gene: [[SJ14819]]
+
* [[RXN-12826]]
** Category: [[annotation]]
+
== Reaction(s) of unknown directionality ==
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
{{#set: common-name=n7-methylguanosine 5'-phosphate}}
* Gene: [[SJ02841]]
+
{{#set: inchi-key=inchikey=aokqnzvjjxpuqa-kqynxxcusa-m}}
** Category: [[annotation]]
+
{{#set: molecular-weight=376.242}}
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
 
* Gene: [[SJ21874]]
 
** Category: [[annotation]]
 
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
 
* Gene: [[SJ22570]]
 
** Category: [[annotation]]
 
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
 
== Pathway(s) ==
 
== Reconstruction information  ==
 
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
== External links  ==
 
{{#set: direction=left-to-right}}
 
{{#set: common-name=phosphatidylcholine 1-acylhydrolase|phospholipase a1}}
 
{{#set: ec-number=ec-3.1.1.32}}
 
{{#set: nb gene associated=5}}
 
{{#set: nb pathway associated=0}}
 
{{#set: reconstruction category=annotation}}
 
{{#set: reconstruction tool=pathwaytools}}
 
{{#set: reconstruction comment=n.a}}
 
{{#set: reconstruction source=saccharina_japonica_genome}}
 

Latest revision as of 11:17, 18 March 2021

Metabolite 7-METHYLGUANOSINE-5-PHOSPHATE

  • common-name:
    • n7-methylguanosine 5'-phosphate
  • smiles:
    • c[n+]1(=cn(c2(n=c(n)nc(=o)c1=2))c3(oc(cop(=o)([o-])[o-])c(o)c(o)3))
  • inchi-key:
    • aokqnzvjjxpuqa-kqynxxcusa-m
  • molecular-weight:
    • 376.242

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality