Difference between revisions of "7-METHYLXANTHINE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite 3-hydroxypimeloyl-ACP-methyl-esters == * common-name: ** a (3r)-3-hydroxypimeloyl-[acp] methyl ester == Reaction(s) known to consume the...") |
(Created page with "Category:metabolite == Metabolite 7-METHYLXANTHINE == * common-name: ** 7-methylxanthine * smiles: ** cn1(c=nc2(nc(=o)nc(=o)c1=2)) * inchi-key: ** pfwlfwpasulgan-uhfffaoys...") |
||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite 7-METHYLXANTHINE == |
* common-name: | * common-name: | ||
| − | ** | + | ** 7-methylxanthine |
| + | * smiles: | ||
| + | ** cn1(c=nc2(nc(=o)nc(=o)c1=2)) | ||
| + | * inchi-key: | ||
| + | ** pfwlfwpasulgan-uhfffaoysa-n | ||
| + | * molecular-weight: | ||
| + | ** 166.139 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[RXN-11521]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=7-methylxanthine}} |
| + | {{#set: inchi-key=inchikey=pfwlfwpasulgan-uhfffaoysa-n}} | ||
| + | {{#set: molecular-weight=166.139}} | ||
Latest revision as of 11:15, 18 March 2021
Contents
Metabolite 7-METHYLXANTHINE
- common-name:
- 7-methylxanthine
- smiles:
- cn1(c=nc2(nc(=o)nc(=o)c1=2))
- inchi-key:
- pfwlfwpasulgan-uhfffaoysa-n
- molecular-weight:
- 166.139
