Difference between revisions of "7-METHYLXANTHINE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=2.7.1.68-RXN 2.7.1.68-RXN] == * direction: ** left-to-right * common-name: ** phosphatidylinositol...")
(Created page with "Category:metabolite == Metabolite 7-METHYLXANTHINE == * common-name: ** 7-methylxanthine * smiles: ** cn1(c=nc2(nc(=o)nc(=o)c1=2)) * inchi-key: ** pfwlfwpasulgan-uhfffaoys...")
 
(7 intermediate revisions by 3 users not shown)
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=2.7.1.68-RXN 2.7.1.68-RXN] ==
+
== Metabolite 7-METHYLXANTHINE ==
−
* direction:
 
−
** left-to-right
 
 
* common-name:
 
* common-name:
−
** phosphatidylinositol 4 phosphate 5 kinase
+
** 7-methylxanthine
−
* ec-number:
+
* smiles:
−
** [http://enzyme.expasy.org/EC/2.7.1.68 ec-2.7.1.68]
+
** cn1(c=nc2(nc(=o)nc(=o)c1=2))
−
== Reaction formula ==
+
* inchi-key:
−
* 1 [[ATP]][c] '''+''' 1 [[CPD-1108]][c] '''=>''' 1 [[ADP]][c] '''+''' 1 [[PHOSPHATIDYL-MYO-INOSITOL-45-BISPHOSPHA]][c] '''+''' 1 [[PROTON]][c]
+
** pfwlfwpasulgan-uhfffaoysa-n
−
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
−
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
+
** 166.139
−
* Gene: [[SJ16914]]
+
== Reaction(s) known to consume the compound ==
−
** Category: [[annotation]]
+
* [[RXN-11521]]
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
== Reaction(s) known to produce the compound ==
−
* Gene: [[SJ15668]]
+
== Reaction(s) of unknown directionality ==
−
** Category: [[annotation]]
+
{{#set: common-name=7-methylxanthine}}
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
{{#set: inchi-key=inchikey=pfwlfwpasulgan-uhfffaoysa-n}}
−
** Category: [[orthology]]
+
{{#set: molecular-weight=166.139}}
−
*** Source: [[output_pantograph_arabidopsis_thaliana]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
 
−
*** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
 
−
* Gene: [[SJ09849]]
 
−
** Category: [[annotation]]
 
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
 
−
** Category: [[orthology]]
 
−
*** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
 
−
* Gene: [[SJ00292]]
 
−
** Category: [[annotation]]
 
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
 
−
* Gene: [[SJ10393]]
 
−
** Category: [[annotation]]
 
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
 
−
* Gene: [[SJ10594]]
 
−
** Category: [[annotation]]
 
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
 
−
* Gene: [[SJ05959]]
 
−
** Category: [[orthology]]
 
−
*** Source: [[output_pantograph_arabidopsis_thaliana]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
 
−
*** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
 
−
* Gene: [[SJ17114]]
 
−
** Category: [[annotation]]
 
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
 
−
** Category: [[orthology]]
 
−
*** Source: [[output_pantograph_arabidopsis_thaliana]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
 
−
*** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
 
−
* Gene: [[SJ00422]]
 
−
** Category: [[annotation]]
 
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
 
−
** Category: [[orthology]]
 
−
*** Source: [[output_pantograph_arabidopsis_thaliana]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
 
−
*** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
 
−
* Gene: [[SJ10098]]
 
−
** Category: [[annotation]]
 
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
 
−
* Gene: [[SJ14817]]
 
−
** Category: [[annotation]]
 
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
 
−
* Gene: [[SJ18422]]
 
−
** Category: [[annotation]]
 
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
 
−
</div>
 
−
== Pathway(s) ==
 
−
* [[PWY-6352]], 3-phosphoinositide biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6352 PWY-6352]
 
−
** '''5''' reactions found over '''8''' reactions in the full pathway
 
−
* [[PWY-6351]], D-myo-inositol (1,4,5)-trisphosphate biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6351 PWY-6351]
 
−
** '''4''' reactions found over '''5''' reactions in the full pathway
 
−
== Reconstruction information  ==
 
−
* category: [[orthology]]; source: [[output_pantograph_arabidopsis_thaliana]]; tool: [[pantograph]]; comment: n.a
 
−
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* category: [[orthology]]; source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
−
== External links  ==
 
−
* RHEA:
 
−
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=14426 14426]
 
−
* LIGAND-RXN:
 
−
** [http://www.genome.jp/dbget-bin/www_bget?R03469 R03469]
 
−
* UNIPROT:
 
−
** [http://www.uniprot.org/uniprot/P48426 P48426]
 
−
** [http://www.uniprot.org/uniprot/Q56YP2 Q56YP2]
 
−
{{#set: direction=left-to-right}}
 
−
{{#set: common-name=phosphatidylinositol 4 phosphate 5 kinase}}
 
−
{{#set: ec-number=ec-2.7.1.68}}
 
−
{{#set: nb gene associated=12}}
 
−
{{#set: nb pathway associated=2}}
 
−
{{#set: reconstruction category=annotation|orthology}}
 
−
{{#set: reconstruction tool=pantograph|pathwaytools}}
 
−
{{#set: reconstruction comment=n.a}}
 
−
{{#set: reconstruction source=output_pantograph_ectocarpus_siliculosus|output_pantograph_arabidopsis_thaliana|saccharina_japonica_genome}}
 

Latest revision as of 11:15, 18 March 2021

Metabolite 7-METHYLXANTHINE

  • common-name:
    • 7-methylxanthine
  • smiles:
    • cn1(c=nc2(nc(=o)nc(=o)c1=2))
  • inchi-key:
    • pfwlfwpasulgan-uhfffaoysa-n
  • molecular-weight:
    • 166.139

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=7-METHYLXANTHINE&oldid=138663"