Difference between revisions of "7Z-3-oxo-hexadec-7-enoyl-ACPs"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite OHyW-tRNAPhe == * common-name: ** 2-hydroxy-wybutosine37 in trnaphe == Reaction(s) known to consume the compound == == Reaction(s) known...") |
(Created page with "Category:metabolite == Metabolite 8-AMINO-7-OXONONANOATE == * common-name: ** 8-amino-7-oxononanoate * smiles: ** cc(c(cccccc([o-])=o)=o)[n+] * inchi-key: ** guahpajoxvyfo...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite 8-AMINO-7-OXONONANOATE == |
* common-name: | * common-name: | ||
− | ** | + | ** 8-amino-7-oxononanoate |
+ | * smiles: | ||
+ | ** cc(c(cccccc([o-])=o)=o)[n+] | ||
+ | * inchi-key: | ||
+ | ** guahpajoxvyfon-uhfffaoysa-n | ||
+ | * molecular-weight: | ||
+ | ** 187.238 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
+ | * [[DAPASYN-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[RXN- | + | * [[7KAPSYN-RXN]] |
+ | * [[DAPASYN-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=8-amino-7-oxononanoate}} |
+ | {{#set: inchi-key=inchikey=guahpajoxvyfon-uhfffaoysa-n}} | ||
+ | {{#set: molecular-weight=187.238}} |
Revision as of 11:14, 15 January 2021
Contents
Metabolite 8-AMINO-7-OXONONANOATE
- common-name:
- 8-amino-7-oxononanoate
- smiles:
- cc(c(cccccc([o-])=o)=o)[n+]
- inchi-key:
- guahpajoxvyfon-uhfffaoysa-n
- molecular-weight:
- 187.238