Difference between revisions of "7Z-3-oxo-hexadec-7-enoyl-ACPs"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite Decanoyl-ACPs == * common-name: ** a decanoyl-[acp] == Reaction(s) known to consume the compound == * RXN-9531 * RXN-9652 == Reac...")
(Created page with "Category:metabolite == Metabolite CPD-6972 == * common-name: ** 4-(2'-carboxyphenyl)-4-oxobutyryl-coa * smiles: ** cc(cop([o-])(=o)op([o-])(=o)occ3(c(c(c(n2(c=nc1(c(=nc=nc...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite Decanoyl-ACPs ==
+
== Metabolite CPD-6972 ==
 
* common-name:
 
* common-name:
** a decanoyl-[acp]
+
** 4-(2'-carboxyphenyl)-4-oxobutyryl-coa
 +
* smiles:
 +
** cc(cop([o-])(=o)op([o-])(=o)occ3(c(c(c(n2(c=nc1(c(=nc=nc=12)n)))o3)o)op([o-])(=o)[o-]))(c)c(c(nccc(nccsc(ccc(c4(c=cc=cc(c([o-])=o)=4))=o)=o)=o)=o)o
 +
* inchi-key:
 +
** kvaqapqxoxtrae-uhfffaoysa-i
 +
* molecular-weight:
 +
** 966.676
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-9531]]
+
* [[NAPHTHOATE-SYN-RXN]]
* [[RXN-9652]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-9530]]
+
* [[NPHS]]
* [[RXN-9660]]
+
* [[O-SUCCINYLBENZOATE-COA-LIG-RXN]]
 +
* [[RXN-7614]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a decanoyl-[acp]}}
+
{{#set: common-name=4-(2'-carboxyphenyl)-4-oxobutyryl-coa}}
 +
{{#set: inchi-key=inchikey=kvaqapqxoxtrae-uhfffaoysa-i}}
 +
{{#set: molecular-weight=966.676}}

Revision as of 15:25, 5 January 2021

Metabolite CPD-6972

  • common-name:
    • 4-(2'-carboxyphenyl)-4-oxobutyryl-coa
  • smiles:
    • cc(cop([o-])(=o)op([o-])(=o)occ3(c(c(c(n2(c=nc1(c(=nc=nc=12)n)))o3)o)op([o-])(=o)[o-]))(c)c(c(nccc(nccsc(ccc(c4(c=cc=cc(c([o-])=o)=4))=o)=o)=o)=o)o
  • inchi-key:
    • kvaqapqxoxtrae-uhfffaoysa-i
  • molecular-weight:
    • 966.676

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality