Difference between revisions of "7Z-hexadec-7-enoyl-ACPs"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite L-EPINEPHRINE == * common-name: ** (r)-adrenaline * smiles: ** c[n+]cc(o)c1(c=cc(=c(c=1)o)o) * inchi-key: ** uctwmzqnuqwslp-vifpvbqesa-o...") |
(Created page with "Category:metabolite == Metabolite METHYL-GLYOXAL == * common-name: ** methylglyoxal * smiles: ** cc([ch]=o)=o * inchi-key: ** aijulsrzwuxgpq-uhfffaoysa-n * molecular-weigh...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite METHYL-GLYOXAL == |
* common-name: | * common-name: | ||
− | ** | + | ** methylglyoxal |
* smiles: | * smiles: | ||
− | ** | + | ** cc([ch]=o)=o |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** aijulsrzwuxgpq-uhfffaoysa-n |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 72.063 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[RXN- | + | * [[D-LACTALDEHYDE-DEHYDROGENASE-RXN]] |
+ | * [[GLYOXI-RXN]] | ||
+ | * [[GLYOXIII-RXN]] | ||
+ | * [[RXN-17627]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[D-LACTALDEHYDE-DEHYDROGENASE-RXN]] | ||
+ | * [[GLYOXI-RXN]] | ||
+ | * [[RXN-17627]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=methylglyoxal}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=aijulsrzwuxgpq-uhfffaoysa-n}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=72.063}} |
Revision as of 08:30, 15 March 2021
Contents
Metabolite METHYL-GLYOXAL
- common-name:
- methylglyoxal
- smiles:
- cc([ch]=o)=o
- inchi-key:
- aijulsrzwuxgpq-uhfffaoysa-n
- molecular-weight:
- 72.063