Difference between revisions of "8-AMINO-7-OXONONANOATE"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ06997 == * transcription-direction: ** negative * right-end-position: ** 40594 * left-end-position: ** 40133 * centisome-position: ** 55.710102...") |
(Created page with "Category:metabolite == Metabolite 8-AMINO-7-OXONONANOATE == * common-name: ** 8-amino-7-oxononanoate * smiles: ** cc(c(cccccc([o-])=o)=o)[n+] * inchi-key: ** guahpajoxvyfo...") |
||
(7 intermediate revisions by 3 users not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite 8-AMINO-7-OXONONANOATE == |
− | * | + | * common-name: |
− | ** | + | ** 8-amino-7-oxononanoate |
− | * | + | * smiles: |
− | ** | + | ** cc(c(cccccc([o-])=o)=o)[n+] |
− | * | + | * inchi-key: |
− | ** | + | ** guahpajoxvyfon-uhfffaoysa-n |
− | * | + | * molecular-weight: |
− | ** | + | ** 187.238 |
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[ | + | * [[DAPASYN-RXN]] |
− | == Reaction(s) | + | == Reaction(s) known to produce the compound == |
− | * [[ | + | * [[7KAPSYN-RXN]] |
− | * | + | * [[DAPASYN-RXN]] |
− | + | == Reaction(s) of unknown directionality == | |
− | {{#set: | + | {{#set: common-name=8-amino-7-oxononanoate}} |
− | {{#set: | + | {{#set: inchi-key=inchikey=guahpajoxvyfon-uhfffaoysa-n}} |
− | + | {{#set: molecular-weight=187.238}} | |
− | {{#set: | ||
− | |||
− |
Latest revision as of 11:12, 18 March 2021
Contents
Metabolite 8-AMINO-7-OXONONANOATE
- common-name:
- 8-amino-7-oxononanoate
- smiles:
- cc(c(cccccc([o-])=o)=o)[n+]
- inchi-key:
- guahpajoxvyfon-uhfffaoysa-n
- molecular-weight:
- 187.238