Difference between revisions of "8-AMINO-7-OXONONANOATE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite Trans-D3-cis-D7-tetradecenoyl-ACPs == * common-name: ** a trans-δ3-cis-δ7-tetradecenoyl-[acp] == Reaction(s) known to consume...")
(Created page with "Category:metabolite == Metabolite 8-AMINO-7-OXONONANOATE == * common-name: ** 8-amino-7-oxononanoate * smiles: ** cc(c(cccccc([o-])=o)=o)[n+] * inchi-key: ** guahpajoxvyfo...")
 
(2 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite Trans-D3-cis-D7-tetradecenoyl-ACPs ==
+
== Metabolite 8-AMINO-7-OXONONANOATE ==
 
* common-name:
 
* common-name:
** a trans-δ3-cis-δ7-tetradecenoyl-[acp]
+
** 8-amino-7-oxononanoate
 +
* smiles:
 +
** cc(c(cccccc([o-])=o)=o)[n+]
 +
* inchi-key:
 +
** guahpajoxvyfon-uhfffaoysa-n
 +
* molecular-weight:
 +
** 187.238
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-10657]]
+
* [[DAPASYN-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-10656]]
+
* [[7KAPSYN-RXN]]
 +
* [[DAPASYN-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a trans-δ3-cis-δ7-tetradecenoyl-[acp]}}
+
{{#set: common-name=8-amino-7-oxononanoate}}
 +
{{#set: inchi-key=inchikey=guahpajoxvyfon-uhfffaoysa-n}}
 +
{{#set: molecular-weight=187.238}}

Latest revision as of 11:12, 18 March 2021

Metabolite 8-AMINO-7-OXONONANOATE

  • common-name:
    • 8-amino-7-oxononanoate
  • smiles:
    • cc(c(cccccc([o-])=o)=o)[n+]
  • inchi-key:
    • guahpajoxvyfon-uhfffaoysa-n
  • molecular-weight:
    • 187.238

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality