Difference between revisions of "8-AMINO-7-OXONONANOATE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite L-1-LYSOPHOSPHATIDATE == * common-name: ** 1-oleyl-2-lyso-phosphatidate * smiles: ** ccccccccc=ccccccccc(=o)occ(cop([o-])([o-])=o)o * inc...") |
(Created page with "Category:metabolite == Metabolite CPD-560 == * common-name: ** s-methyl-5-thio-d-ribose * smiles: ** cscc1(oc(c(c1o)o)o) * inchi-key: ** olvvoviftbsbbh-jdjsbbgdsa-n * mole...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-560 == |
* common-name: | * common-name: | ||
| − | ** | + | ** s-methyl-5-thio-d-ribose |
* smiles: | * smiles: | ||
| − | ** | + | ** cscc1(oc(c(c1o)o)o) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** olvvoviftbsbbh-jdjsbbgdsa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 180.218 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[METHYLTHIOADENOSINE-NUCLEOSIDASE-RXN]] |
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=s-methyl-5-thio-d-ribose}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=olvvoviftbsbbh-jdjsbbgdsa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=180.218}} |
Revision as of 15:25, 5 January 2021
Contents
Metabolite CPD-560
- common-name:
- s-methyl-5-thio-d-ribose
- smiles:
- cscc1(oc(c(c1o)o)o)
- inchi-key:
- olvvoviftbsbbh-jdjsbbgdsa-n
- molecular-weight:
- 180.218
