Difference between revisions of "9Z-3-oxo-octadec-9-enoyl-ACPs"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-4203 == * common-name: ** n6-(δ2-isopentenyl)-adenosine 5'-diphosphate * smiles: ** cc(=ccnc3(=nc=nc2(n(c1(c(c(c(o1)cop(op(=o)(...")
(Created page with "Category:metabolite == Metabolite CPD-1083 == * common-name: ** (e)-2-methylcrotonoyl-coa * smiles: ** cc=c(c)c(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-4203 ==
+
== Metabolite CPD-1083 ==
 
* common-name:
 
* common-name:
** n6-(δ2-isopentenyl)-adenosine 5'-diphosphate
+
** (e)-2-methylcrotonoyl-coa
 
* smiles:
 
* smiles:
** cc(=ccnc3(=nc=nc2(n(c1(c(c(c(o1)cop(op(=o)([o-])[o-])([o-])=o)o)o))c=nc=23)))c
+
** cc=c(c)c(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 
* inchi-key:
 
* inchi-key:
** vxmxkdahjurhen-sdbhatresa-k
+
** pmwatmxoqqznbx-dkbzllmosa-j
 
* molecular-weight:
 
* molecular-weight:
** 492.298
+
** 845.604
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-4311]]
+
* [[2-MEBUCOA-FAD-RXN]]
 +
* [[ECH_LPAREN_3hmbcoa_RPAREN_]]
 +
* [[RXN-14266]]
 +
* [[TIGLYLCOA-HYDROXY-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-4305]]
+
* [[2-MEBUCOA-FAD-RXN]]
* [[RXN-4311]]
+
* [[MCDH_LPAREN_2mb2coa_RPAREN_]]
 +
* [[RXN-14266]]
 +
* [[TIGLYLCOA-HYDROXY-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=n6-(δ2-isopentenyl)-adenosine 5'-diphosphate}}
+
{{#set: common-name=(e)-2-methylcrotonoyl-coa}}
{{#set: inchi-key=inchikey=vxmxkdahjurhen-sdbhatresa-k}}
+
{{#set: inchi-key=inchikey=pmwatmxoqqznbx-dkbzllmosa-j}}
{{#set: molecular-weight=492.298}}
+
{{#set: molecular-weight=845.604}}

Revision as of 08:26, 15 March 2021

Metabolite CPD-1083

  • common-name:
    • (e)-2-methylcrotonoyl-coa
  • smiles:
    • cc=c(c)c(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
  • inchi-key:
    • pmwatmxoqqznbx-dkbzllmosa-j
  • molecular-weight:
    • 845.604

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality