Difference between revisions of "9Z-3-oxo-octadec-9-enoyl-ACPs"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite L-THYROXINE == * common-name: ** l-thyroxine * smiles: ** c(=o)([o-])c([n+])cc1(c=c(i)c(=c(i)c=1)oc2(=cc(i)=c(o)c(i)=c2)) * inchi-key: **...") |
(Created page with "Category:metabolite == Metabolite Menaquinols == * common-name: ** a menaquinol == Reaction(s) known to consume the compound == * RXN-14107 == Reaction(s) known to pro...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite Menaquinols == |
* common-name: | * common-name: | ||
| − | ** | + | ** a menaquinol |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[RXN-14107]] |
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[RXN-11046]] | ||
| + | * [[RXN-15740]] | ||
| + | * [[RXN0-6554]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=a menaquinol}} |
| − | |||
| − | |||
Revision as of 14:55, 5 January 2021
Contents
Metabolite Menaquinols
- common-name:
- a menaquinol
