Difference between revisions of "A-5-prime-PP-5-prime-RNA"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=ITCY ITCY] == * direction: ** left-to-right * common-name: ** itp:cytidine 5'-phosphotransferase ==...")
(Created page with "Category:metabolite == Metabolite CPD-12119 == * common-name: ** demethylmenaquinol-10 * smiles: ** cc(=cccc(=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(...")
Line 1: Line 1:
[[Category:reaction]]
+
[[Category:metabolite]]
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=ITCY ITCY] ==
+
== Metabolite CPD-12119 ==
* direction:
 
** left-to-right
 
 
* common-name:
 
* common-name:
** itp:cytidine 5'-phosphotransferase
+
** demethylmenaquinol-10
== Reaction formula ==
+
* smiles:
* 1.0 [[CYTIDINE]][c] '''+''' 1.0 [[ITP]][c] '''=>''' 1.0 [[CMP]][c] '''+''' 1.0 [[IDP]][c] '''+''' 1.0 [[PROTON]][c]
+
** cc(=cccc(=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc1(c=c(o)c2(c=cc=cc(c(o)=1)=2)))c)c
== Gene(s) associated with this reaction  ==
+
* inchi-key:
* Gene: [[SJ02034]]
+
** fnbtzsjwsslppl-alcxcgrtsa-n
** Category: [[orthology]]
+
* molecular-weight:
*** Source: [[output_pantograph_nannochloropsis_salina]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
** 841.354
* Gene: [[SJ15690]]
+
== Reaction(s) known to consume the compound ==
** Category: [[orthology]]
+
* [[RXN-9361]]
*** Source: [[output_pantograph_nannochloropsis_salina]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
== Reaction(s) known to produce the compound ==
== Pathway(s) ==
+
== Reaction(s) of unknown directionality ==
== Reconstruction information  ==
+
{{#set: common-name=demethylmenaquinol-10}}
* category: [[orthology]]; source: [[output_pantograph_nannochloropsis_salina]]; tool: [[pantograph]]; comment: n.a
+
{{#set: inchi-key=inchikey=fnbtzsjwsslppl-alcxcgrtsa-n}}
== External links  ==
+
{{#set: molecular-weight=841.354}}
{{#set: direction=left-to-right}}
 
{{#set: common-name=itp:cytidine 5'-phosphotransferase}}
 
{{#set: nb gene associated=2}}
 
{{#set: nb pathway associated=0}}
 
{{#set: reconstruction category=orthology}}
 
{{#set: reconstruction tool=pantograph}}
 
{{#set: reconstruction comment=n.a}}
 
{{#set: reconstruction source=output_pantograph_nannochloropsis_salina}}
 

Revision as of 20:36, 18 December 2020

Metabolite CPD-12119

  • common-name:
    • demethylmenaquinol-10
  • smiles:
    • cc(=cccc(=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc1(c=c(o)c2(c=cc=cc(c(o)=1)=2)))c)c
  • inchi-key:
    • fnbtzsjwsslppl-alcxcgrtsa-n
  • molecular-weight:
    • 841.354

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality