Difference between revisions of "A-GALACTOSYLCERAMIDE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-403 == * common-name: ** 3-hydroxy-4-methylanthranilate * smiles: ** cc1(=cc=c(c(=c1o)n)c([o-])=o) * inchi-key: ** oyzonaxdawhdmn-uhf...") |
(Created page with "Category:metabolite == Metabolite A-GALACTOSYLCERAMIDE == * common-name: ** a β-d-galactosyl-n-acylsphingosine == Reaction(s) known to consume the compound == * RXN...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite A-GALACTOSYLCERAMIDE == |
* common-name: | * common-name: | ||
| − | ** | + | ** a β-d-galactosyl-n-acylsphingosine |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[RXN-18301]] |
| + | * [[RXN-18302]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=a β-d-galactosyl-n-acylsphingosine}} |
| − | |||
| − | |||
Latest revision as of 11:15, 18 March 2021
Contents
Metabolite A-GALACTOSYLCERAMIDE
- common-name:
- a β-d-galactosyl-n-acylsphingosine
