Difference between revisions of "A-pyruvate-dehydrogenase-E2-protein-Nsup"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-17047 == * common-name: ** 3-benzyl-3,6 -bis(cysteinylglycine)- 6-(hydroxymethyl)-diketopiperazine * smiles: ** c(sc2(cc1(=cc=cc=c1))...")
(Created page with "Category:metabolite == Metabolite a-pyruvate-dehydrogenase-E2-protein-Nsup == * common-name: ** a [pyruvate dehydrogenase e2 protein] n6-octanoyl-l-lysine == Reaction(s) k...")
 
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
−
== Metabolite CPD-17047 ==
+
== Metabolite a-pyruvate-dehydrogenase-E2-protein-Nsup ==
 
* common-name:
 
* common-name:
−
** 3-benzyl-3,6 -bis(cysteinylglycine)- 6-(hydroxymethyl)-diketopiperazine
+
** a [pyruvate dehydrogenase e2 protein] n6-octanoyl-l-lysine
−
* smiles:
 
−
** c(sc2(cc1(=cc=cc=c1))(nc(=o)c(scc(c(ncc([o-])=o)=o)[n+])(co)nc(=o)2))c(c(ncc([o-])=o)=o)[n+]
 
−
* inchi-key:
 
−
** chbulttudaiwdp-hcihmxrssa-n
 
−
* molecular-weight:
 
−
** 586.634
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-14957]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
−
* [[RXN-15681]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
−
{{#set: common-name=3-benzyl-3,6 -bis(cysteinylglycine)- 6-(hydroxymethyl)-diketopiperazine}}
+
{{#set: common-name=a [pyruvate dehydrogenase e2 protein] n6-octanoyl-l-lysine}}
−
{{#set: inchi-key=inchikey=chbulttudaiwdp-hcihmxrssa-n}}
 
−
{{#set: molecular-weight=586.634}}
 

Latest revision as of 11:11, 18 March 2021

Metabolite a-pyruvate-dehydrogenase-E2-protein-Nsup

  • common-name:
    • a [pyruvate dehydrogenase e2 protein] n6-octanoyl-l-lysine

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "a [pyruvate dehydrogenase e2 protein] n6-octanoyl-l-lysine" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=A-pyruvate-dehydrogenase-E2-protein-Nsup&oldid=136942"