Difference between revisions of "ACET"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-6994 == * common-name: ** (2s)-eriodictyol * smiles: ** c3(c(c2(oc1(c=c(c=c(c=1c(c2)=o)o)[o-])))=cc(=c(c=3)o)o) * inchi-key: ** sbhxy...") |
(Created page with "Category:metabolite == Metabolite 25S-rRNA-N1-methyladenine-2142 == * common-name: ** n1-methyladenine2142 in 25s rrna == Reaction(s) known to consume the compound == == R...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite 25S-rRNA-N1-methyladenine-2142 == |
* common-name: | * common-name: | ||
| − | ** | + | ** n1-methyladenine2142 in 25s rrna |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[RXN-14549]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=n1-methyladenine2142 in 25s rrna}} |
| − | |||
| − | |||
Revision as of 15:29, 5 January 2021
Contents
Metabolite 25S-rRNA-N1-methyladenine-2142
- common-name:
- n1-methyladenine2142 in 25s rrna
