Difference between revisions of "ACETALD"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD0-1074 == * common-name: ** aminomethylphosphonate * smiles: ** c(p([o-])(=o)[o-])[n+] * inchi-key: ** mgrvrxrgtboshw-uhfffaoysa-m * m...") |
(Created page with "Category:metabolite == Metabolite CPD-14604 == * common-name: ** mycophenolic acid phenolic glucuronide * smiles: ** cc(ccc([o-])=o)=ccc2(=c(c(c)=c3(coc(=o)c(=c(oc1(c(o)c(...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-14604 == |
* common-name: | * common-name: | ||
| − | ** | + | ** mycophenolic acid phenolic glucuronide |
* smiles: | * smiles: | ||
| − | ** | + | ** cc(ccc([o-])=o)=ccc2(=c(c(c)=c3(coc(=o)c(=c(oc1(c(o)c(c(o)c(c([o-])=o)o1)o))2)3))oc) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** byfgtsayqqiucn-hgihdbqlsa-l |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 494.451 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[RXN-13608]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=mycophenolic acid phenolic glucuronide}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=byfgtsayqqiucn-hgihdbqlsa-l}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=494.451}} |
Revision as of 11:16, 15 January 2021
Contents
Metabolite CPD-14604
- common-name:
- mycophenolic acid phenolic glucuronide
- smiles:
- cc(ccc([o-])=o)=ccc2(=c(c(c)=c3(coc(=o)c(=c(oc1(c(o)c(c(o)c(c([o-])=o)o1)o))2)3))oc)
- inchi-key:
- byfgtsayqqiucn-hgihdbqlsa-l
- molecular-weight:
- 494.451
