Difference between revisions of "ACETALD"

Latest revision as of 11:14, 18 March 2021

@@ Line 1: / Line 1: @@
 [[Category:metabolite]]
-== Metabolite CPD-14604 ==
+== Metabolite ACETALD ==
 * common-name:
-** mycophenolic acid phenolic glucuronide
+** acetaldehyde
 * smiles:
-** cc(ccc([o-])=o)=ccc2(=c(c(c)=c3(coc(=o)c(=c(oc1(c(o)c(c(o)c(c([o-])=o)o1)o))2)3))oc)
+** c[ch]=o
 * inchi-key:
-** byfgtsayqqiucn-hgihdbqlsa-l
+** ikhguxgnuitlkf-uhfffaoysa-n
 * molecular-weight:
-** 494.451
+** 44.053
 == Reaction(s) known to consume the compound ==
+* [[ALCDH_LPAREN_nadp_RPAREN_hi]]
+* [[ALCDH_LPAREN_nadp_RPAREN_i]]
+* [[ALCOHOL-DEHYDROG-RXN]]
+* [[RXN-12484]]
+* [[RXN66-3]]
 == Reaction(s) known to produce the compound ==
-* [[RXN-13608]]
+* [[2-NITROPROPANE-DIOXYGENASE-RXN]]
+* [[ALCOHOL-DEHYDROG-RXN]]
+* [[LTAA-RXN]]
+* [[RXN0-5234]]
+* [[RXN0-986]]
+* [[RXN66-1]]
+* [[THREONINE-ALDOLASE-RXN]]
 == Reaction(s) of unknown directionality ==
-{{#set: common-name=mycophenolic acid phenolic glucuronide}}
+{{#set: common-name=acetaldehyde}}
-{{#set: inchi-key=inchikey=byfgtsayqqiucn-hgihdbqlsa-l}}
+{{#set: inchi-key=inchikey=ikhguxgnuitlkf-uhfffaoysa-n}}
-{{#set: molecular-weight=494.451}}
+{{#set: molecular-weight=44.053}}