Difference between revisions of "ACETALD"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-14604 == * common-name: ** mycophenolic acid phenolic glucuronide * smiles: ** cc(ccc([o-])=o)=ccc2(=c(c(c)=c3(coc(=o)c(=c(oc1(c(o)c(...")
(Created page with "Category:metabolite == Metabolite ACETALD == * common-name: ** acetaldehyde * smiles: ** c[ch]=o * inchi-key: ** ikhguxgnuitlkf-uhfffaoysa-n * molecular-weight: ** 44.053...")
 
(5 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-14604 ==
+
== Metabolite ACETALD ==
 
* common-name:
 
* common-name:
** mycophenolic acid phenolic glucuronide
+
** acetaldehyde
 
* smiles:
 
* smiles:
** cc(ccc([o-])=o)=ccc2(=c(c(c)=c3(coc(=o)c(=c(oc1(c(o)c(c(o)c(c([o-])=o)o1)o))2)3))oc)
+
** c[ch]=o
 
* inchi-key:
 
* inchi-key:
** byfgtsayqqiucn-hgihdbqlsa-l
+
** ikhguxgnuitlkf-uhfffaoysa-n
 
* molecular-weight:
 
* molecular-weight:
** 494.451
+
** 44.053
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[ALCDH_LPAREN_nadp_RPAREN_hi]]
 +
* [[ALCDH_LPAREN_nadp_RPAREN_i]]
 +
* [[ALCOHOL-DEHYDROG-RXN]]
 +
* [[RXN-12484]]
 +
* [[RXN66-3]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-13608]]
+
* [[2-NITROPROPANE-DIOXYGENASE-RXN]]
 +
* [[ALCOHOL-DEHYDROG-RXN]]
 +
* [[LTAA-RXN]]
 +
* [[RXN0-5234]]
 +
* [[RXN0-986]]
 +
* [[RXN66-1]]
 +
* [[THREONINE-ALDOLASE-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=mycophenolic acid phenolic glucuronide}}
+
{{#set: common-name=acetaldehyde}}
{{#set: inchi-key=inchikey=byfgtsayqqiucn-hgihdbqlsa-l}}
+
{{#set: inchi-key=inchikey=ikhguxgnuitlkf-uhfffaoysa-n}}
{{#set: molecular-weight=494.451}}
+
{{#set: molecular-weight=44.053}}

Latest revision as of 11:14, 18 March 2021

Metabolite ACETALD

  • common-name:
    • acetaldehyde
  • smiles:
    • c[ch]=o
  • inchi-key:
    • ikhguxgnuitlkf-uhfffaoysa-n
  • molecular-weight:
    • 44.053

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality