Difference between revisions of "ACETALD"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-11495 == * common-name: ** (2-hydroxyphenyl)acetate * smiles: ** c(=o)([o-])cc1(=c(o)c=cc=c1) * inchi-key: ** ccvyrrgzdbshfu-uhfffaoy...") |
(Created page with "Category:metabolite == Metabolite ACETALD == * common-name: ** acetaldehyde * smiles: ** c[ch]=o * inchi-key: ** ikhguxgnuitlkf-uhfffaoysa-n * molecular-weight: ** 44.053...") |
||
(4 intermediate revisions by 2 users not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite ACETALD == |
* common-name: | * common-name: | ||
− | ** | + | ** acetaldehyde |
* smiles: | * smiles: | ||
− | ** c | + | ** c[ch]=o |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** ikhguxgnuitlkf-uhfffaoysa-n |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 44.053 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
+ | * [[ALCDH_LPAREN_nadp_RPAREN_hi]] | ||
+ | * [[ALCDH_LPAREN_nadp_RPAREN_i]] | ||
+ | * [[ALCOHOL-DEHYDROG-RXN]] | ||
+ | * [[RXN-12484]] | ||
+ | * [[RXN66-3]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[RXN- | + | * [[2-NITROPROPANE-DIOXYGENASE-RXN]] |
+ | * [[ALCOHOL-DEHYDROG-RXN]] | ||
+ | * [[LTAA-RXN]] | ||
+ | * [[RXN0-5234]] | ||
+ | * [[RXN0-986]] | ||
+ | * [[RXN66-1]] | ||
+ | * [[THREONINE-ALDOLASE-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=acetaldehyde}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=ikhguxgnuitlkf-uhfffaoysa-n}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=44.053}} |
Latest revision as of 11:14, 18 March 2021
Contents
Metabolite ACETALD
- common-name:
- acetaldehyde
- smiles:
- c[ch]=o
- inchi-key:
- ikhguxgnuitlkf-uhfffaoysa-n
- molecular-weight:
- 44.053
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
- 2-NITROPROPANE-DIOXYGENASE-RXN
- ALCOHOL-DEHYDROG-RXN
- LTAA-RXN
- RXN0-5234
- RXN0-986
- RXN66-1
- THREONINE-ALDOLASE-RXN