Difference between revisions of "ACETALD"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-14604 == * common-name: ** mycophenolic acid phenolic glucuronide * smiles: ** cc(ccc([o-])=o)=ccc2(=c(c(c)=c3(coc(=o)c(=c(oc1(c(o)c(...") |
(Created page with "Category:metabolite == Metabolite CPD-11495 == * common-name: ** (2-hydroxyphenyl)acetate * smiles: ** c(=o)([o-])cc1(=c(o)c=cc=c1) * inchi-key: ** ccvyrrgzdbshfu-uhfffaoy...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite CPD- | + | == Metabolite CPD-11495 == |
* common-name: | * common-name: | ||
| − | ** | + | ** (2-hydroxyphenyl)acetate |
* smiles: | * smiles: | ||
| − | ** | + | ** c(=o)([o-])cc1(=c(o)c=cc=c1) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** ccvyrrgzdbshfu-uhfffaoysa-m |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 151.141 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[RXN-10815]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=(2-hydroxyphenyl)acetate}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=ccvyrrgzdbshfu-uhfffaoysa-m}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=151.141}} |
Revision as of 15:27, 5 January 2021
Contents
Metabolite CPD-11495
- common-name:
- (2-hydroxyphenyl)acetate
- smiles:
- c(=o)([o-])cc1(=c(o)c=cc=c1)
- inchi-key:
- ccvyrrgzdbshfu-uhfffaoysa-m
- molecular-weight:
- 151.141
