Difference between revisions of "ACETALD"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-11495 == * common-name: ** (2-hydroxyphenyl)acetate * smiles: ** c(=o)([o-])cc1(=c(o)c=cc=c1) * inchi-key: ** ccvyrrgzdbshfu-uhfffaoy...") |
(Created page with "Category:metabolite == Metabolite 2-DEHYDROPANTOATE == * common-name: ** 2-dehydropantoate * smiles: ** cc(c(=o)c([o-])=o)(co)c * inchi-key: ** pkvvtuwhanfmqc-uhfffaoysa-m...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite 2-DEHYDROPANTOATE == |
* common-name: | * common-name: | ||
| − | ** | + | ** 2-dehydropantoate |
* smiles: | * smiles: | ||
| − | ** c(=o)([o-]) | + | ** cc(c(=o)c([o-])=o)(co)c |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** pkvvtuwhanfmqc-uhfffaoysa-m |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 145.135 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[2-DEHYDROPANTOATE-REDUCT-RXN]] | ||
| + | * [[3-CH3-2-OXOBUTANOATE-OH-CH3-XFER-RXN]] | ||
| + | * [[KETOPANTOALDOLASE-RXN]] | ||
| + | * [[MOHMT]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[3-CH3-2-OXOBUTANOATE-OH-CH3-XFER-RXN]] |
| + | * [[KETOPANTOALDOLASE-RXN]] | ||
| + | * [[MOHMT]] | ||
| + | * [[MTMOHT]] | ||
| + | * [[RXN-15635]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=2-dehydropantoate}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=pkvvtuwhanfmqc-uhfffaoysa-m}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=145.135}} |
Revision as of 13:10, 14 January 2021
Contents
Metabolite 2-DEHYDROPANTOATE
- common-name:
- 2-dehydropantoate
- smiles:
- cc(c(=o)c([o-])=o)(co)c
- inchi-key:
- pkvvtuwhanfmqc-uhfffaoysa-m
- molecular-weight:
- 145.135
