Difference between revisions of "ACETOACETYL-COA"
Jump to navigation
Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-9237 RXN-9237] == * direction: ** left-to-right * common-name: ** 3-demethylubiquinone-10 3-o-m...") |
(Created page with "Category:metabolite == Metabolite UMP == * common-name: ** ump * smiles: ** c(op(=o)([o-])[o-])c1(oc(c(o)c(o)1)n2(c=cc(=o)nc(=o)2)) * inchi-key: ** djjcxfvjdgthfx-xvfcmesi...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:metabolite]] |
| − | == | + | == Metabolite UMP == |
| − | |||
| − | |||
* common-name: | * common-name: | ||
| − | ** | + | ** ump |
| − | * | + | * smiles: |
| − | ** | + | ** c(op(=o)([o-])[o-])c1(oc(c(o)c(o)1)n2(c=cc(=o)nc(=o)2)) |
| − | * | + | * inchi-key: |
| − | ** | + | ** djjcxfvjdgthfx-xvfcmesisa-l |
| − | == Reaction | + | * molecular-weight: |
| − | * | + | ** 322.168 |
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * | + | * [[RXN-12002]] |
| − | ** | + | * [[RXN-14025]] |
| − | *** | + | * [[RXN-8975]] |
| − | * | + | * [[UDPGALth]] |
| − | ** | + | * [[UMPP]] |
| − | ** | + | == Reaction(s) known to produce the compound == |
| − | + | <div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;"> | |
| − | * [[ | + | * [[2.7.8.15-RXN]] |
| − | * | + | * [[2.7.8.17-RXN]] |
| − | * [[ | + | * [[AUPT]] |
| − | * | + | * [[DATUP]] |
| − | + | * [[DCTUP]] | |
| − | * | + | * [[DGTUP]] |
| − | + | * [[DTTUP]] | |
| − | * | + | * [[DUTUP]] |
| − | * | + | * [[GTUP]] |
| − | + | * [[ITUP]] | |
| − | {{#set: common-name= | + | * [[OROTPDECARB-RXN]] |
| − | {{#set: | + | * [[ORPDC]] |
| − | + | * [[PHOSNACMURPENTATRANS-RXN]] | |
| − | {{#set: | + | * [[RXN-11347]] |
| − | + | * [[RXN-12197]] | |
| − | + | * [[RXN-12199]] | |
| − | + | * [[RXN-14139]] | |
| − | + | * [[RXN-8975]] | |
| − | + | * [[UDPGALth]] | |
| + | * [[URACIL-PRIBOSYLTRANS-RXN]] | ||
| + | * [[URIDINEKIN-RXN]] | ||
| + | * [[URKI-RXN]] | ||
| + | * [[UTPPH]] | ||
| + | * [[UTUP]] | ||
| + | </div> | ||
| + | == Reaction(s) of unknown directionality == | ||
| + | {{#set: common-name=ump}} | ||
| + | {{#set: inchi-key=inchikey=djjcxfvjdgthfx-xvfcmesisa-l}} | ||
| + | {{#set: molecular-weight=322.168}} | ||
Revision as of 20:37, 18 December 2020
Contents
Metabolite UMP
- common-name:
- ump
- smiles:
- c(op(=o)([o-])[o-])c1(oc(c(o)c(o)1)n2(c=cc(=o)nc(=o)2))
- inchi-key:
- djjcxfvjdgthfx-xvfcmesisa-l
- molecular-weight:
- 322.168
