Difference between revisions of "ACETOACETYL-COA"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite UMP == * common-name: ** ump * smiles: ** c(op(=o)([o-])[o-])c1(oc(c(o)c(o)1)n2(c=cc(=o)nc(=o)2)) * inchi-key: ** djjcxfvjdgthfx-xvfcmesi...")
(Created page with "Category:metabolite == Metabolite CPD-12117 == * common-name: ** demethylmenaquinol-7 * smiles: ** cc(=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc1(c=c(o)c2(c=cc=c...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite UMP ==
+
== Metabolite CPD-12117 ==
 
* common-name:
 
* common-name:
** ump
+
** demethylmenaquinol-7
 
* smiles:
 
* smiles:
** c(op(=o)([o-])[o-])c1(oc(c(o)c(o)1)n2(c=cc(=o)nc(=o)2))
+
** cc(=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc1(c=c(o)c2(c=cc=cc(c(o)=1)=2)))c
 
* inchi-key:
 
* inchi-key:
** djjcxfvjdgthfx-xvfcmesisa-l
+
** ufzdimbxtvrbds-ssqlmynasa-n
 
* molecular-weight:
 
* molecular-weight:
** 322.168
+
** 636.999
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-12002]]
+
* [[RXN-9191]]
* [[RXN-14025]]
 
* [[RXN-8975]]
 
* [[UDPGALth]]
 
* [[UMPP]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
 
* [[2.7.8.15-RXN]]
 
* [[2.7.8.17-RXN]]
 
* [[AUPT]]
 
* [[DATUP]]
 
* [[DCTUP]]
 
* [[DGTUP]]
 
* [[DTTUP]]
 
* [[DUTUP]]
 
* [[GTUP]]
 
* [[ITUP]]
 
* [[OROTPDECARB-RXN]]
 
* [[ORPDC]]
 
* [[PHOSNACMURPENTATRANS-RXN]]
 
* [[RXN-11347]]
 
* [[RXN-12197]]
 
* [[RXN-12199]]
 
* [[RXN-14139]]
 
* [[RXN-8975]]
 
* [[UDPGALth]]
 
* [[URACIL-PRIBOSYLTRANS-RXN]]
 
* [[URIDINEKIN-RXN]]
 
* [[URKI-RXN]]
 
* [[UTPPH]]
 
* [[UTUP]]
 
</div>
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=ump}}
+
{{#set: common-name=demethylmenaquinol-7}}
{{#set: inchi-key=inchikey=djjcxfvjdgthfx-xvfcmesisa-l}}
+
{{#set: inchi-key=inchikey=ufzdimbxtvrbds-ssqlmynasa-n}}
{{#set: molecular-weight=322.168}}
+
{{#set: molecular-weight=636.999}}

Revision as of 15:00, 5 January 2021

Metabolite CPD-12117

  • common-name:
    • demethylmenaquinol-7
  • smiles:
    • cc(=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc1(c=c(o)c2(c=cc=cc(c(o)=1)=2)))c
  • inchi-key:
    • ufzdimbxtvrbds-ssqlmynasa-n
  • molecular-weight:
    • 636.999

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality