Difference between revisions of "ACETOACETYL-COA"

Revision as of 15:30, 5 January 2021

@@ Line 1: / Line 1: @@
 [[Category:metabolite]]
-== Metabolite CPD-12117 ==
+== Metabolite UMP ==
 * common-name:
-** demethylmenaquinol-7
+** ump
 * smiles:
-** cc(=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc1(c=c(o)c2(c=cc=cc(c(o)=1)=2)))c
+** c(op(=o)([o-])[o-])c1(oc(c(o)c(o)1)n2(c=cc(=o)nc(=o)2))
 * inchi-key:
-** ufzdimbxtvrbds-ssqlmynasa-n
+** djjcxfvjdgthfx-xvfcmesisa-l
 * molecular-weight:
-** 636.999
+** 322.168
 == Reaction(s) known to consume the compound ==
-* [[RXN-9191]]
+* [[RXN-12002]]
+* [[RXN-14025]]
+* [[RXN-8975]]
+* [[UDPGALth]]
+* [[UMPP]]
 == Reaction(s) known to produce the compound ==
+<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
+* [[2.7.8.15-RXN]]
+* [[2.7.8.17-RXN]]
+* [[AUPT]]
+* [[DATUP]]
+* [[DCTUP]]
+* [[DGTUP]]
+* [[DTTUP]]
+* [[DUTUP]]
+* [[GTUP]]
+* [[ITUP]]
+* [[OROTPDECARB-RXN]]
+* [[ORPDC]]
+* [[PHOSNACMURPENTATRANS-RXN]]
+* [[RXN-11347]]
+* [[RXN-12197]]
+* [[RXN-12199]]
+* [[RXN-14139]]
+* [[RXN-8975]]
+* [[UDPGALth]]
+* [[URACIL-PRIBOSYLTRANS-RXN]]
+* [[URIDINEKIN-RXN]]
+* [[URKI-RXN]]
+* [[UTPPH]]
+* [[UTUP]]
+</div>
 == Reaction(s) of unknown directionality ==
-{{#set: common-name=demethylmenaquinol-7}}
+{{#set: common-name=ump}}
-{{#set: inchi-key=inchikey=ufzdimbxtvrbds-ssqlmynasa-n}}
+{{#set: inchi-key=inchikey=djjcxfvjdgthfx-xvfcmesisa-l}}
-{{#set: molecular-weight=636.999}}
+{{#set: molecular-weight=322.168}}